![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | Polygon-green2-bottom-left.svg | 2023-09-18 13:29 | 161 | |
![[IMG]](/icons/image2.gif) | Polygon-green-big.svg | 2023-09-18 13:29 | 164 | |
![[IMG]](/icons/image2.gif) | Polygon-big.svg | 2023-09-18 13:29 | 167 | |
![[IMG]](/icons/image2.gif) | Rectangle--green-bottom-left.svg | 2023-09-18 13:29 | 167 | |
![[IMG]](/icons/image2.gif) | Rectangle--yellow-bottom-left.svg | 2023-09-18 13:29 | 167 | |
![[IMG]](/icons/image2.gif) | Rectangle--green-top-right.svg | 2023-09-18 13:29 | 175 | |
![[IMG]](/icons/image2.gif) | Rectangle--yellow-top-right.svg | 2023-09-18 13:29 | 176 | |
![[IMG]](/icons/image2.gif) | Rectangle--green-top-left.svg | 2023-09-18 13:29 | 177 | |
![[IMG]](/icons/image2.gif) | Rectangle--yellow-top-left.svg | 2023-09-18 13:29 | 177 | |
![[IMG]](/icons/image2.gif) | Rectangle--blue-top-left.svg | 2023-09-18 13:29 | 178 | |
![[IMG]](/icons/image2.gif) | union-minus.svg | 2023-09-18 13:29 | 179 | |
![[IMG]](/icons/image2.gif) | Polygon--blue-bottom-right.svg | 2023-09-18 13:29 | 204 | |
![[IMG]](/icons/image2.gif) | Polygon-green-bottom-right.svg | 2023-09-18 13:29 | 204 | |
![[IMG]](/icons/image2.gif) | Polygon-blue-top-left.svg | 2023-09-18 13:29 | 210 | |
![[IMG]](/icons/image2.gif) | Polygon-yellow-top-right.svg | 2023-09-18 13:29 | 210 | |
![[IMG]](/icons/image2.gif) | Rectangle--blue-top-right.svg | 2023-09-18 13:29 | 218 | |
![[IMG]](/icons/image2.gif) | play-icon.svg | 2023-09-18 13:29 | 222 | |
![[IMG]](/icons/image2.gif) | Rectangle--blue-bottom-left.svg | 2023-09-18 13:29 | 224 | |
![[IMG]](/icons/image2.gif) | icon-play.svg | 2023-09-18 13:29 | 225 | |
![[IMG]](/icons/image2.gif) | icon-plus.svg | 2023-09-18 13:29 | 234 | |
![[IMG]](/icons/image2.gif) | Polygon-yellow-top-left.svg | 2023-09-18 13:29 | 236 | |
![[IMG]](/icons/image2.gif) | Polygon-green-bright-bottom-left.svg | 2023-09-18 13:29 | 260 | |
![[IMG]](/icons/image2.gif) | pause-icon.svg | 2023-09-18 13:29 | 270 | |
![[IMG]](/icons/image2.gif) | union-plus.svg | 2023-09-18 13:29 | 274 | |
![[IMG]](/icons/image2.gif) | quote.svg | 2023-09-18 13:29 | 300 | |
![[IMG]](/icons/image2.gif) | select-arrow.svg | 2023-09-18 13:29 | 515 | |
![[IMG]](/icons/image2.gif) | icon-course.svg | 2023-09-18 13:29 | 559 | |
![[IMG]](/icons/image2.gif) | icon-union.svg | 2023-09-18 13:29 | 595 | |
![[IMG]](/icons/image2.gif) | icon-tiles.svg | 2023-09-18 13:29 | 639 | |
![[IMG]](/icons/image2.gif) | icon-search.svg | 2023-09-18 13:29 | 640 | |
![[IMG]](/icons/image2.gif) | favicon-16x16-1.png | 2023-09-18 13:29 | 781 | |
![[ ]](/icons/unknown.gif) | icomoon.ttf | 2025-03-19 09:43 | 1.4K | |
![[ ]](/icons/unknown.gif) | icomoon.woff | 2025-03-19 09:43 | 1.5K | |
![[ ]](/icons/unknown.gif) | icomoon.eot | 2025-03-19 09:43 | 1.6K | |
![[IMG]](/icons/image2.gif) | favicon-32x32-1.png | 2023-09-18 13:29 | 1.9K | |
![[IMG]](/icons/image2.gif) | icomoon.svg | 2025-03-19 09:43 | 1.9K | |
![[IMG]](/icons/image2.gif) | Lorraine Brennan 3-100x83.jpg | 2023-09-18 13:29 | 2.3K | |
![[IMG]](/icons/image2.gif) | Karina_Pierce_headshot-100x108.jpg | 2023-09-18 13:29 | 2.8K | |
![[IMG]](/icons/image2.gif) | Trudee Fair-100x118.jpg | 2023-09-18 13:29 | 3.0K | |
![[IMG]](/icons/image2.gif) | stafflisting-placeholder.png | 2025-01-29 13:12 | 3.0K | |
![[IMG]](/icons/image2.gif) | Dara-Stanley_96x134.jpg | 2023-09-18 13:29 | 3.2K | |
![[IMG]](/icons/image2.gif) | 98w-michael-wallace.jpg | 2023-09-18 13:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | Bernard-Kaye.jpg | 2023-09-18 13:29 | 3.7K | |
![[IMG]](/icons/image2.gif) | logo-ucd-120x120 (002).jpg | 2023-09-18 13:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | 1409_Forrest_M_014a-100x125.jpg | 2023-09-18 13:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | Damien-Dempsey.jpg | 2023-09-18 13:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | James-Breen.jpg | 2023-09-18 13:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | Denise-Cunningham.jpg | 2023-09-18 13:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | Tommy-Boland.jpg | 2023-09-18 13:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | Alan-Kelly.jpg | 2023-09-18 13:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | Niamh-Harbourne.jpg | 2023-09-18 13:29 | 3.9K | |
![[IMG]](/icons/image2.gif) | Snaoibhe_Bolger_96x134.jpg | 2023-09-18 13:29 | 3.9K | |
![[IMG]](/icons/image2.gif) | Thomas-Cummins.jpg | 2023-09-18 13:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | John-ODoherty.jpg | 2023-09-18 13:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | Tom-Mc-Cabe.jpg | 2023-09-18 13:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | Anne-Markey.jpg | 2023-09-18 13:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | Pat-Gibbons.jpg | 2023-09-18 13:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | Eileen-Gibney.jpg | 2023-09-18 13:29 | 4.1K | |
![[IMG]](/icons/image2.gif) | Gerry-Looby.jpg | 2023-09-18 13:29 | 4.1K | |
![[IMG]](/icons/image2.gif) | Alan-Fahey.jpg | 2023-09-18 13:29 | 4.2K | |
![[IMG]](/icons/image2.gif) | Saoirse-Tracy.jpg | 2025-02-24 15:09 | 4.2K | |
![[IMG]](/icons/image2.gif) | John-Browne.jpg | 2023-09-18 13:29 | 4.2K | |
![[IMG]](/icons/image2.gif) | Angela-Feechan.jpg | 2023-09-18 13:29 | 4.2K | |
![[IMG]](/icons/image2.gif) | Amalia-Scannell.jpg | 2023-09-18 13:29 | 4.2K | |
![[IMG]](/icons/image2.gif) | Sulagna-Maitra.jpg | 2023-09-18 13:29 | 4.2K | |
![[IMG]](/icons/image2.gif) | Aifric-OSullivan.jpg | 2023-09-18 13:29 | 4.3K | |
![[IMG]](/icons/image2.gif) | Mary-Flood.jpg | 2023-09-18 13:29 | 4.3K | |
![[IMG]](/icons/image2.gif) | Conor-OReilly.jpg | 2023-09-18 13:29 | 4.3K | |
![[IMG]](/icons/image2.gif) | Deirdre-OConnor.jpg | 2023-09-18 13:29 | 4.4K | |
![[IMG]](/icons/image2.gif) | Gillian-McGrath.jpg | 2023-09-18 13:29 | 4.4K | |
![[IMG]](/icons/image2.gif) | Aoife-Byrne.jpg | 2023-09-18 13:29 | 4.4K | |
![[IMG]](/icons/image2.gif) | Eithne-Mooney.jpg | 2023-09-18 13:29 | 4.5K | |
![[IMG]](/icons/image2.gif) | Bernie-Flynn.jpg | 2023-09-18 13:29 | 4.5K | |
![[IMG]](/icons/image2.gif) | Kevin-McDonnell.jpg | 2025-02-24 15:09 | 4.6K | |
![[IMG]](/icons/image2.gif) | Catherine-Byrne.jpg | 2023-09-18 13:29 | 4.6K | |
![[IMG]](/icons/image2.gif) | Maarten-Nieuwenhuis.jpg | 2023-09-18 13:29 | 4.6K | |
![[IMG]](/icons/image2.gif) | Vincenzo--Delgrippo.jpg | 2023-09-18 13:29 | 4.6K | |
![[IMG]](/icons/image2.gif) | Trudee-Fair.jpg | 2023-09-18 13:29 | 4.7K | |
![[IMG]](/icons/image2.gif) | 96w_Saskia-van-Ruth.jpg | 2025-01-30 15:39 | 4.8K | |
![[IMG]](/icons/image2.gif) | 96w_Ajay-Menon.jpg | 2025-01-30 15:39 | 4.8K | |
![[IMG]](/icons/image2.gif) | 96w_Cathal_McCabe.jpg | 2025-01-30 15:09 | 4.8K | |
![[IMG]](/icons/image2.gif) | Karen-Keaveney.jpg | 2023-09-28 11:47 | 4.9K | |
![[IMG]](/icons/image2.gif) | Edel-Kelly.jpg | 2023-09-18 13:29 | 4.9K | |
![[IMG]](/icons/image2.gif) | RTE_Brainstorm.jpg | 2023-09-18 13:29 | 4.9K | |
![[IMG]](/icons/image2.gif) | 96w_Simon_Hodge.jpg | 2023-09-18 13:29 | 5.0K | |
![[IMG]](/icons/image2.gif) | JC-Jacquier.jpg | 2023-09-18 13:29 | 5.0K | |
![[IMG]](/icons/image2.gif) | C_Elliott-Kingston.jpg | 2023-09-18 13:29 | 5.0K | |
![[IMG]](/icons/image2.gif) | Karina-Pierce.jpg | 2023-09-18 13:29 | 5.1K | |
![[IMG]](/icons/image2.gif) | Breige-McNulty.jpg | 2023-09-18 13:29 | 5.1K | |
![[IMG]](/icons/image2.gif) | Karen-Holland.jpg | 2023-09-18 13:29 | 5.2K | |
![[IMG]](/icons/image2.gif) | Barry-McMahon.jpg | 2023-09-18 13:29 | 5.2K | |
![[IMG]](/icons/image2.gif) | 96w-Kieran-Meade.jpg | 2023-09-18 13:29 | 5.3K | |
![[IMG]](/icons/image2.gif) | Barbara-Murphy.jpg | 2023-09-18 13:29 | 5.5K | |
![[IMG]](/icons/image2.gif) | Helen-Sheridan.jpg | 2023-09-18 13:29 | 5.7K | |
![[IMG]](/icons/image2.gif) | 96w-Laura.jpg | 2023-09-18 13:29 | 5.7K | |
![[IMG]](/icons/image2.gif) | Pat-Lonergan.jpg | 2023-09-18 13:29 | 5.8K | |
![[IMG]](/icons/image2.gif) | Bloom_small.jpg | 2023-09-18 13:29 | 6.0K | |
![[IMG]](/icons/image2.gif) | 96w_David_Brogan.jpg | 2023-09-18 13:29 | 6.0K | |
![[IMG]](/icons/image2.gif) | 2020-Agriculture-Forestry_Top50.jpg | 2023-09-18 13:29 | 6.1K | |
![[IMG]](/icons/image2.gif) | 96w_Martina_Wallace .jpg | 2023-09-18 13:29 | 6.1K | |
![[IMG]](/icons/image2.gif) | RTE_News.png | 2023-09-18 13:29 | 6.2K | |
![[IMG]](/icons/image2.gif) | 96w_Magdalena_Necpalova.jpg | 2023-09-18 13:29 | 6.3K | |
![[IMG]](/icons/image2.gif) | 96w_Julie_Dowsett.jpg | 2023-09-18 13:29 | 6.3K | |
![[IMG]](/icons/image2.gif) | Marie-Doyle.jpg | 2023-09-18 13:29 | 6.3K | |
![[IMG]](/icons/image2.gif) | 96w-Stafford-Vigors.jpg | 2023-09-18 13:29 | 6.4K | |
![[IMG]](/icons/image2.gif) | Macra_MAIS_Mobile.jpg | 2023-09-18 13:29 | 6.4K | |
![[IMG]](/icons/image2.gif) | 96w-Zoe-McKay.jpg | 2023-09-18 13:29 | 6.5K | |
![[IMG]](/icons/image2.gif) | 96w-franci-li.jpg | 2023-09-18 13:29 | 6.5K | |
![[IMG]](/icons/image2.gif) | 2020_US_NEWS_2020.jpg | 2023-09-18 13:29 | 6.5K | |
![[IMG]](/icons/image2.gif) | 96w-j-burke.jpg | 2023-09-18 13:29 | 6.6K | |
![[IMG]](/icons/image2.gif) | 96w_Simona_Grasso.jpg | 2023-09-18 13:29 | 6.9K | |
![[IMG]](/icons/image2.gif) | Bridget Lynch Seminar-250x188.jpg | 2023-09-18 13:29 | 7.0K | |
![[IMG]](/icons/image2.gif) | 96w-d-stead.jpg | 2023-09-18 13:29 | 7.1K | |
![[IMG]](/icons/image2.gif) | nesc_logo-web.jpg | 2023-09-18 13:29 | 7.1K | |
![[IMG]](/icons/image2.gif) | Summer_School_web_news.png | 2023-09-18 13:29 | 7.2K | |
![[IMG]](/icons/image2.gif) | 96w_Aleksandra_Konic-Ristic.jpg | 2023-09-18 13:29 | 7.4K | |
![[IMG]](/icons/image2.gif) | Web_News_Small.jpg | 2023-09-18 13:29 | 7.6K | |
![[IMG]](/icons/image2.gif) | Farm-Walk-Bridget2-small.jpg | 2023-09-18 13:29 | 7.6K | |
![[IMG]](/icons/image2.gif) | 96w-Sinead-Flannery.jpg | 2023-09-18 13:29 | 7.7K | |
![[IMG]](/icons/image2.gif) | 96w-james-kinsella.jpg | 2023-09-18 13:29 | 7.7K | |
![[IMG]](/icons/image2.gif) | 96w-alex-evans.jpg | 2023-09-18 13:29 | 7.8K | |
![[IMG]](/icons/image2.gif) | default-staff-blank-silhouette-9.jpg | 2024-12-18 12:13 | 7.9K | |
![[IMG]](/icons/image2.gif) | 96w-Marco-Garcia-Vaquero.jpg | 2023-09-18 13:29 | 8.0K | |
![[IMG]](/icons/image2.gif) | 96w-james-lyng.jpg | 2023-09-18 13:29 | 8.1K | |
![[IMG]](/icons/image2.gif) | 96w-paul-murphy.jpg | 2023-09-18 13:29 | 8.1K | |
![[IMG]](/icons/image2.gif) | 96w-nigel-brunton.jpg | 2023-09-18 13:29 | 8.4K | |
![[IMG]](/icons/image2.gif) | 96w-lorraine-brennan.jpg | 2023-09-18 13:29 | 8.5K | |
![[IMG]](/icons/image2.gif) | 96w-emm-hill.jpg | 2023-09-18 13:29 | 8.5K | |
![[IMG]](/icons/image2.gif) | 96w-aine-niDhubh.jpg | 2023-09-18 13:29 | 8.6K | |
![[IMG]](/icons/image2.gif) | AgriAware_2020_Launch_Small.jpg | 2023-09-18 13:29 | 9.1K | |
![[IMG]](/icons/image2.gif) | 96W_Joey_Henchy.jpg | 2023-09-18 13:29 | 9.4K | |
![[IMG]](/icons/image2.gif) | 96W_Stephen_Kehoe.jpg | 2023-09-18 13:29 | 9.5K | |
![[IMG]](/icons/image2.gif) | Website_news-2.png | 2023-09-18 13:29 | 9.8K | |
![[IMG]](/icons/image2.gif) | 96w-schmidt.jpg | 2023-09-18 13:29 | 9.8K | |
![[IMG]](/icons/image2.gif) | 96E_Sarah_Keenan.jpg | 2023-09-18 13:29 | 9.9K | |
![[IMG]](/icons/image2.gif) | 96w-m-gorman.jpg | 2023-09-18 13:29 | 9.9K | |
![[IMG]](/icons/image2.gif) | 96W_Brian_Leonard.jpg | 2023-09-18 13:29 | 10K | |
![[IMG]](/icons/image2.gif) | 35-250x167.jpg | 2023-09-18 13:29 | 10K | |
![[IMG]](/icons/image2.gif) | knowledge transfer2.jpeg | 2025-04-09 17:12 | 10K | |
![[IMG]](/icons/image2.gif) | Barry_Image_web.jpg | 2023-09-18 13:29 | 10K | |
![[IMG]](/icons/image2.gif) | Web_Cover.png | 2023-09-18 13:29 | 10K | |
![[IMG]](/icons/image2.gif) | IMG_7204-250x188.jpeg | 2023-09-18 13:29 | 11K | |
![[IMG]](/icons/image2.gif) | Farmers_Monthly_March_Web_News.png | 2023-09-18 13:29 | 11K | |
![[IMG]](/icons/image2.gif) | Website_news.png | 2023-09-18 13:29 | 11K | |
![[IMG]](/icons/image2.gif) | Morning_Ireland.png | 2023-09-18 13:29 | 11K | |
![[IMG]](/icons/image2.gif) | Countrywide_RTE_.png | 2023-09-18 13:29 | 11K | |
![[IMG]](/icons/image2.gif) | Soapbox_web_news.png | 2023-09-18 13:29 | 12K | |
![[IMG]](/icons/image2.gif) | Barry_Image-300x188.jpg | 2024-01-13 21:47 | 12K | |
![[IMG]](/icons/image2.gif) | Online Information_website_news.png | 2023-09-18 13:29 | 12K | |
![[IMG]](/icons/image2.gif) | EarToTheGround_Web_News.png | 2023-09-18 13:29 | 12K | |
![[IMG]](/icons/image2.gif) | Agri-Matters.png | 2023-09-18 13:29 | 12K | |
![[IMG]](/icons/image2.gif) | SoilStation.png | 2023-09-18 13:29 | 12K | |
![[IMG]](/icons/image2.gif) | MAIS_Web_News.png | 2023-09-18 13:29 | 12K | |
![[ ]](/icons/unknown.gif) | la-regular-400-1.woff2 | 2023-09-18 13:29 | 13K | |
![[IMG]](/icons/image2.gif) | DN250 Web News.png | 2023-09-18 13:29 | 13K | |
![[IMG]](/icons/image2.gif) | 96W_Aisling_Reilly.jpg | 2023-09-18 13:29 | 13K | |
![[IMG]](/icons/image2.gif) | Image 60-350x233.JPG | 2024-01-13 21:47 | 13K | |
![[IMG]](/icons/image2.gif) | FDC_Website.png | 2023-09-18 13:29 | 13K | |
![[IMG]](/icons/image2.gif) | Ag_Soc_Image.png | 2023-09-18 13:29 | 13K | |
![[IMG]](/icons/image2.gif) | Mooney_Goes_Wild_Web_News.jpg | 2023-09-18 13:29 | 13K | |
![[IMG]](/icons/image2.gif) | fwat_web_news.png | 2023-09-18 13:29 | 13K | |
![[IMG]](/icons/image2.gif) | Dairytech acknowledgements-582x121.jpg | 2023-09-18 13:29 | 14K | |
![[IMG]](/icons/image2.gif) | AgSoc_Cheque_Presentation_2021_Web_News.png | 2023-09-18 13:29 | 14K | |
![[IMG]](/icons/image2.gif) | Frank_Web.png | 2023-09-18 13:29 | 14K | |
![[IMG]](/icons/image2.gif) | 96w-Fiona-Lalor.jpg | 2023-09-18 13:29 | 14K | |
![[IMG]](/icons/image2.gif) | SFI_Awareds_2020.png | 2023-09-18 13:29 | 14K | |
![[IMG]](/icons/image2.gif) | Website_news-1.png | 2023-09-18 13:29 | 14K | |
![[IMG]](/icons/image2.gif) | Research_CaseStude_Web_News.png | 2023-09-18 13:29 | 14K | |
![[IMG]](/icons/image2.gif) | PPID_Equine_Research_120x120px.jpg | 2023-09-18 13:29 | 14K | |
![[IMG]](/icons/image2.gif) | Image 50-350x233.jpg | 2024-01-13 21:47 | 14K | |
![[IMG]](/icons/image2.gif) | IWD_Website_newsheadline.png | 2023-09-18 13:29 | 14K | |
![[IMG]](/icons/image2.gif) | Dara Stanley web.png | 2023-09-18 13:29 | 14K | |
![[IMG]](/icons/image2.gif) | Web_News-1.png | 2024-01-13 21:47 | 14K | |
![[IMG]](/icons/image2.gif) | Bloom Knowledge.png | 2023-09-18 13:29 | 15K | |
![[IMG]](/icons/image2.gif) | Careers_Day_2020_WebNews.gif | 2023-09-18 13:29 | 15K | |
![[IMG]](/icons/image2.gif) | Image Home Page.png | 2023-09-18 13:29 | 15K | |
![[IMG]](/icons/image2.gif) | Image70-350x214.jpg | 2024-01-13 21:47 | 15K | |
![[ ]](/icons/unknown.gif) | la-regular-400-1.woff | 2023-09-18 13:29 | 15K | |
![[IMG]](/icons/image2.gif) | 96w_Frank_Monahan.jpg | 2023-09-18 13:29 | 15K | |
![[IMG]](/icons/image2.gif) | Image 11-350x233.JPG | 2024-01-13 21:47 | 16K | |
![[IMG]](/icons/image2.gif) | Image66-350x166.jpg | 2024-01-13 21:47 | 16K | |
![[IMG]](/icons/image2.gif) | Dara Stanley (002)-250x333.jpg | 2024-01-13 21:47 | 16K | |
![[IMG]](/icons/image2.gif) | 96W_Tesfaye_Bedane.jpg | 2023-09-18 13:29 | 16K | |
![[IMG]](/icons/image2.gif) | donal o'neill camida copy-443x299.jpg | 2024-10-30 11:16 | 17K | |
![[IMG]](/icons/image2.gif) | key dates.jpeg | 2024-01-13 20:17 | 17K | |
![[IMG]](/icons/image2.gif) | dick.jpeg | 2024-01-27 01:17 | 17K | |
![[IMG]](/icons/image2.gif) | Image 21-350x233.JPG | 2024-01-13 21:47 | 18K | |
![[IMG]](/icons/image2.gif) | crest-ucd.svg | 2023-09-18 13:29 | 18K | |
![[IMG]](/icons/image2.gif) | web_Genomic_Selection_in_Plant_Breeding_II-328x424.jpg | 2023-09-18 13:29 | 18K | |
![[IMG]](/icons/image2.gif) | Lyons 30-350x263.jpg | 2024-01-13 21:47 | 18K | |
![[IMG]](/icons/image2.gif) | international.jpeg | 2024-01-13 20:17 | 19K | |
![[IMG]](/icons/image2.gif) | logo-footer.svg | 2023-09-18 13:29 | 19K | |
![[IMG]](/icons/image2.gif) | 96w_Irene_Rose.jpg | 2023-09-18 13:29 | 19K | |
![[IMG]](/icons/image2.gif) | 96w_Daniel-Hurley.jpg | 2023-09-18 13:29 | 20K | |
![[IMG]](/icons/image2.gif) | Staff profile_SharleenOReilly.jpg | 2023-09-18 13:29 | 20K | |
![[IMG]](/icons/image2.gif) | grid-repeat-1.png | 2023-09-18 13:29 | 20K | |
![[IMG]](/icons/image2.gif) | The_Hard_Shoulder-650x340.jfif | 2024-01-13 21:47 | 20K | |
![[IMG]](/icons/image2.gif) | 96W_Mohd_Faheem_Khan.jpg | 2024-02-16 15:48 | 21K | |
![[IMG]](/icons/image2.gif) | 147 HQ4A9712-689x459.JPG | 2024-11-22 14:11 | 21K | |
![[IMG]](/icons/image2.gif) | MIAS Image-650x198.jpg | 2024-01-13 21:47 | 21K | |
![[IMG]](/icons/image2.gif) | Jeziel_Panorama.jpg | 2024-01-13 21:47 | 21K | |
![[IMG]](/icons/image2.gif) | Image 9a-350x259.jpg | 2024-01-13 21:47 | 22K | |
![[IMG]](/icons/image2.gif) | apple-touch-icon-1.png | 2023-09-18 13:29 | 22K | |
![[IMG]](/icons/image2.gif) | JOD_DAFM_Launch.png | 2023-09-18 13:29 | 22K | |
![[IMG]](/icons/image2.gif) | Staffprofile_EmmaFeeney.jpg | 2023-09-18 13:29 | 22K | |
![[IMG]](/icons/image2.gif) | 96w_Noeleen_Smyth.jpg | 2023-09-18 13:29 | 23K | |
![[IMG]](/icons/image2.gif) | Aine_Forestry_Report_120x120.jpg | 2023-09-18 13:29 | 23K | |
![[IMG]](/icons/image2.gif) | Lyons 31-350x263.jpg | 2024-01-13 21:47 | 23K | |
![[IMG]](/icons/image2.gif) | 96W Amanda Sosa.jpg | 2024-10-15 12:15 | 23K | |
![[IMG]](/icons/image2.gif) | Lyons 32a-350x253.jpg | 2024-01-13 21:47 | 23K | |
![[IMG]](/icons/image2.gif) | 96w_Kevin_Daly.jpg | 2024-06-13 09:44 | 24K | |
![[IMG]](/icons/image2.gif) | Damien_O'Reilly-650x366.jpg | 2024-01-13 21:47 | 24K | |
![[IMG]](/icons/image2.gif) | Michael_Wallace_Feb_2022-750x310.JPG | 2024-01-13 21:47 | 25K | |
![[IMG]](/icons/image2.gif) | Kevin McDonnell small.jpg | 2023-09-18 13:29 | 25K | |
![[IMG]](/icons/image2.gif) | ronan-gormley-205w214h.jpg | 2024-01-13 21:47 | 25K | |
![[IMG]](/icons/image2.gif) | Staffprofile_DavidMacHugh1.jpg | 2023-09-18 13:29 | 26K | |
![[IMG]](/icons/image2.gif) | GLhOOjuWEAAW0mM-695x463.jpeg | 2024-04-19 16:45 | 26K | |
![[IMG]](/icons/image2.gif) | 96W_Syed_Bilal_Hussain.jpg | 2023-11-03 15:48 | 27K | |
![[IMG]](/icons/image2.gif) | Mooney_Goes_Wild_Web_News_Mainpage-750x260.jpg | 2024-01-13 21:47 | 27K | |
![[IMG]](/icons/image2.gif) | Food_Safety_Web_Title_2.jpg | 2023-09-18 13:29 | 27K | |
![[IMG]](/icons/image2.gif) | Horticulture.jpg | 2023-09-18 13:29 | 27K | |
![[IMG]](/icons/image2.gif) | ASA_IFJ_Bursary_2020_mobile.png | 2023-09-18 13:29 | 27K | |
![[IMG]](/icons/image2.gif) | Staffprofile_TomasRussell.jpg | 2023-09-18 13:29 | 27K | |
![[IMG]](/icons/image2.gif) | karina-pierce-205w214h.jpg | 2024-01-13 21:47 | 27K | |
![[ ]](/icons/unknown.gif) | Lato-Black.woff2 | 2023-09-18 13:29 | 28K | |
![[ ]](/icons/unknown.gif) | Lato-Bold.woff2 | 2023-09-18 13:29 | 28K | |
![[IMG]](/icons/image2.gif) | W_HU_REPORTING.jpg | 2024-10-03 13:15 | 28K | |
![[ ]](/icons/unknown.gif) | Lato-Regular.woff2 | 2023-09-18 13:29 | 29K | |
![[IMG]](/icons/image2.gif) | 369728878_697998049032611_9067667191002738769_n.jpg | 2024-01-11 17:17 | 30K | |
![[ ]](/icons/unknown.gif) | Lato-Italic.woff2 | 2023-09-18 13:29 | 30K | |
![[IMG]](/icons/image2.gif) | Stephen_Robb_25_10__Cropped-1729851092834.jpg--newtowncunningham_farmer_is_new_presenter_on_ear_to_the_ground-1-688x344.jpg | 2025-02-12 23:42 | 30K | |
![[IMG]](/icons/image2.gif) | Climate_Targets_RTE.jpg | 2024-01-13 21:47 | 30K | |
![[IMG]](/icons/image2.gif) | UCD4ALL_cropped-751x265.jpg | 2023-09-18 13:29 | 30K | |
![[IMG]](/icons/image2.gif) | california fires-726x408.jpg | 2025-02-21 17:39 | 31K | |
![[IMG]](/icons/image2.gif) | SAFS_PromotionalSlide-650x366.jpg | 2024-01-13 21:47 | 32K | |
![[IMG]](/icons/image2.gif) | Dara_Stanley_News_Website.png | 2023-09-18 13:29 | 32K | |
![[IMG]](/icons/image2.gif) | Sustainable_Food_Systems_Image.jpg | 2023-11-09 16:27 | 32K | |
![[IMG]](/icons/image2.gif) | news-headline-default.png | 2023-09-18 13:29 | 32K | |
![[IMG]](/icons/image2.gif) | DairyTech Image 2-664x319.jpg | 2023-09-18 13:29 | 33K | |
![[IMG]](/icons/image2.gif) | UCDNOVA_Lyons_120x120.png | 2023-09-18 13:29 | 33K | |
![[ ]](/icons/unknown.gif) | la-regular-400-1.ttf | 2023-09-18 13:29 | 33K | |
![[IMG]](/icons/image2.gif) | Horticulutre_2019-500x333.JPG | 2024-01-13 21:47 | 33K | |
![[ ]](/icons/unknown.gif) | la-regular-400-1.eot | 2023-09-18 13:29 | 33K | |
![[IMG]](/icons/image2.gif) | Executive_Education_Web_Grid2.png | 2023-09-18 13:29 | 34K | |
![[IMG]](/icons/image2.gif) | PERSONA - update.png | 2025-04-06 18:12 | 34K | |
![[IMG]](/icons/image2.gif) | InsideGrid_AgExt2.jpg | 2023-09-18 13:29 | 34K | |
![[IMG]](/icons/image2.gif) | mairead3-670x509.jpg | 2024-09-24 22:44 | 34K | |
![[IMG]](/icons/image2.gif) | Staffprofile_BrianTobin.jpg | 2023-09-18 13:29 | 35K | |
![[IMG]](/icons/image2.gif) | UPDATED_SoapboxScienceDublin_Poster2021-450x563.jpg | 2025-02-24 15:09 | 35K | |
![[IMG]](/icons/image2.gif) | orientation.jpeg | 2024-01-11 17:17 | 35K | |
![[IMG]](/icons/image2.gif) | kirstie women in Ag-705x471.jpg | 2025-01-31 23:39 | 35K | |
![[IMG]](/icons/image2.gif) | ucd sign course search.jpeg | 2024-01-13 20:17 | 35K | |
![[ ]](/icons/unknown.gif) | Lato-Black.woff | 2023-09-18 13:29 | 35K | |
![[IMG]](/icons/image2.gif) | FWT_Web_News_Headline_2.png | 2023-09-18 13:29 | 36K | |
![[IMG]](/icons/image2.gif) | NutriGem Graph 2.png | 2023-09-18 13:29 | 36K | |
![[ ]](/icons/unknown.gif) | Lato-Bold.woff | 2023-09-18 13:29 | 36K | |
![[IMG]](/icons/image2.gif) | shane o'brien -672x448.jpg | 2024-10-29 20:16 | 36K | |
![[ ]](/icons/unknown.gif) | Lato-Regular.woff | 2023-09-18 13:29 | 37K | |
![[IMG]](/icons/image2.gif) | macra1.jpeg | 2025-05-26 01:42 | 37K | |
![[IMG]](/icons/image2.gif) | Stephen_Robb_25_10__Cropped-1729851092834.jpg--newtowncunningham_farmer_is_new_presenter_on_ear_to_the_ground.jpg | 2025-02-12 23:41 | 38K | |
![[IMG]](/icons/image2.gif) | AS_Award_Mobile_120.png | 2023-09-18 13:29 | 38K | |
![[IMG]](/icons/image2.gif) | rams-696x616.jpeg | 2025-02-01 00:39 | 38K | |
![[ ]](/icons/unknown.gif) | Lato-Italic.woff | 2023-09-18 13:29 | 38K | |
![[IMG]](/icons/image2.gif) | sheep1-671x503.jpeg | 2025-02-01 00:39 | 38K | |
![[IMG]](/icons/image2.gif) | 22-23_School_Awards_Ceremony_image1.jpg | 2024-01-13 21:47 | 39K | |
![[IMG]](/icons/image2.gif) | PPID_group_image_barbara_2-650x325.jpeg | 2024-01-13 21:47 | 39K | |
![[IMG]](/icons/image2.gif) | nova accelerate 2-690x460.jpeg | 2024-04-19 16:45 | 39K | |
![[IMG]](/icons/image2.gif) | 2020-US-NEWS-RANKINGS-711x320.jpg | 2024-01-13 21:47 | 39K | |
![[IMG]](/icons/image2.gif) | 1712134634584-710x473.jpeg | 2024-04-05 19:15 | 40K | |
![[IMG]](/icons/image2.gif) | Innov_Support_Lge.jpg | 2024-01-13 21:47 | 40K | |
![[IMG]](/icons/image2.gif) | DAFM Launch -750x568.JPG | 2024-01-13 21:47 | 40K | |
![[IMG]](/icons/image2.gif) | GLcTSJMXAAAiLHG-686x457.jpeg | 2024-04-19 16:45 | 41K | |
![[IMG]](/icons/image2.gif) | helen sheridan.jpeg | 2024-01-13 22:17 | 41K | |
![[IMG]](/icons/image2.gif) | IMG-20231213-WA0002-661x496.jpg | 2024-02-19 21:17 | 42K | |
![[IMG]](/icons/image2.gif) | Equine Press Release Image 04.07.19 - Web Small.png | 2023-09-18 13:29 | 42K | |
![[IMG]](/icons/image2.gif) | christopher cahill-673x448.jpg | 2024-09-25 20:44 | 42K | |
![[ ]](/icons/unknown.gif) | MAIS and MExt -Application Form-2018.docx | 2024-01-13 21:47 | 42K | |
![[IMG]](/icons/image2.gif) | XZHL8030-697x464.jpg | 2024-07-10 13:15 | 42K | |
![[IMG]](/icons/image2.gif) | Staff_Home_Page2.png | 2023-09-18 13:29 | 43K | |
![[IMG]](/icons/image2.gif) | Prof_Dip_FSREgSc_Grid.png | 2023-09-18 13:29 | 43K | |
![[IMG]](/icons/image2.gif) | MScSustFoodProc_Web_Grid_2.jpg | 2023-09-18 13:29 | 43K | |
![[IMG]](/icons/image2.gif) | one health2-635x423.jpeg | 2024-02-25 21:48 | 43K | |
![[IMG]](/icons/image2.gif) | alumni-montage.jpg | 2023-09-18 13:29 | 44K | |
![[IMG]](/icons/image2.gif) | NO FEE TEAGASC PROF DIP RESEARCH DEVELOPMENT MX-6-750x500.jpg | 2024-01-13 21:47 | 44K | |
![[IMG]](/icons/image2.gif) | IMG-20240315-WA0003-692x390.JPG | 2024-04-05 19:15 | 44K | |
![[IMG]](/icons/image2.gif) | SFI Awards 21_DS_UCD-650x326.jpg | 2024-01-13 21:47 | 44K | |
![[IMG]](/icons/image2.gif) | 17-lake-2163_077D small-1-750x271.jpg | 2024-01-13 21:47 | 45K | |
![[IMG]](/icons/image2.gif) | Research_CaseStude_Web_News_Main-750x358.png | 2024-01-13 21:47 | 46K | |
![[IMG]](/icons/image2.gif) | DSC_6347-710x473.JPG | 2024-10-31 15:47 | 46K | |
![[TXT]](/icons/text.gif) | app.min.js | 2025-01-24 17:43 | 46K | |
![[IMG]](/icons/image2.gif) | timanfaya.jpg | 2024-01-13 21:47 | 46K | |
![[IMG]](/icons/image2.gif) | shane o'brien .jpg | 2024-10-29 20:16 | 47K | |
![[IMG]](/icons/image2.gif) | our rural future-681x410.jpeg | 2024-05-27 11:17 | 47K | |
![[IMG]](/icons/image2.gif) | adeb8563-0946-45cb-b846-838f21bd6018-703x528.JPG | 2024-06-13 12:14 | 47K | |
![[IMG]](/icons/image2.gif) | Paul Slade1_Curlew-678x453.jpg | 2024-06-28 20:14 | 47K | |
![[IMG]](/icons/image2.gif) | Claire Mc Cormack .jpg | 2023-09-18 13:29 | 48K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Careers Day 2015.jpg | 2024-01-13 21:47 | 48K | |
![[IMG]](/icons/image2.gif) | UCD LGBY.png | 2023-09-18 13:29 | 48K | |
![[IMG]](/icons/image2.gif) | Athena Swan Silver-718x360.jpg | 2023-09-18 13:29 | 49K | |
![[IMG]](/icons/image2.gif) | 09 HQ4A3097-722x481.JPG | 2025-02-27 10:42 | 50K | |
![[IMG]](/icons/image2.gif) | 17-lake-2163_077D small-750x307.jpg | 2024-01-13 21:47 | 50K | |
![[IMG]](/icons/image2.gif) | IMG_4092-686x683.jpg | 2024-09-25 20:44 | 50K | |
![[IMG]](/icons/image2.gif) | eyeon.ie-404753-725x483.jpg | 2025-02-26 22:39 | 50K | |
![[IMG]](/icons/image2.gif) | 47 HQ4A9542-701x479.JPG | 2024-11-22 14:11 | 50K | |
![[IMG]](/icons/image2.gif) | IMG_6115-681x545.jpeg | 2024-05-31 10:46 | 51K | |
![[IMG]](/icons/image2.gif) | eartotheground-750x404.jpg | 2024-01-13 21:47 | 51K | |
![[IMG]](/icons/image2.gif) | 34 HQ4A9517-694x491.JPG | 2024-11-22 14:11 | 51K | |
![[IMG]](/icons/image2.gif) | Lyons Dairy Herd Image.png | 2023-09-18 13:29 | 51K | |
![[IMG]](/icons/image2.gif) | FNH - Grid.png | 2023-09-18 13:29 | 51K | |
![[IMG]](/icons/image2.gif) | 52938f25-2643-4bd2-9720-527e07a6c87c-690x517.JPG | 2024-04-05 19:15 | 52K | |
![[IMG]](/icons/image2.gif) | Image 1-750x500.JPG | 2024-01-13 21:47 | 53K | |
![[IMG]](/icons/image2.gif) | 151 E25A0884-695x506.jpg | 2024-03-01 14:50 | 53K | |
![[IMG]](/icons/image2.gif) | LLDL7649-703x461.jpeg | 2024-07-10 13:15 | 53K | |
![[IMG]](/icons/image2.gif) | Farm4Life_Web_Grid.png | 2023-09-18 13:29 | 53K | |
![[IMG]](/icons/image2.gif) | mikayla ploughing-728x436.jpg | 2024-11-01 18:17 | 53K | |
![[IMG]](/icons/image2.gif) | China-Ireland-Sustainable-Dairy-Development-Centre-2.jpg | 2024-01-13 21:47 | 54K | |
![[IMG]](/icons/image2.gif) | 89 HQ4A3477-723x518.JPG | 2025-02-27 10:42 | 54K | |
![[IMG]](/icons/image2.gif) | Farm Walk Bridget2-700x352.jpg | 2024-01-13 21:47 | 54K | |
![[IMG]](/icons/image2.gif) | Orientation -750x356.jpg | 2023-09-18 13:29 | 55K | |
![[IMG]](/icons/image2.gif) | 118 HQ4A6736-663x442.JPG | 2025-02-13 21:09 | 55K | |
![[IMG]](/icons/image2.gif) | John-Roche-flat-3.jpg.jpg | 2025-05-08 11:43 | 56K | |
![[IMG]](/icons/image2.gif) | 20240626-teagasc-208-723x482.jpg | 2024-06-28 12:44 | 56K | |
![[IMG]](/icons/image2.gif) | Soil_Monitoring_Station-1-650x433.jpg | 2024-01-13 21:47 | 56K | |
![[IMG]](/icons/image2.gif) | AgSoc 2.-750x500.JPG | 2024-01-13 21:47 | 56K | |
![[IMG]](/icons/image2.gif) | EDI_Workplace_Policies_cropped-751x395.jpg | 2023-09-18 13:29 | 56K | |
![[IMG]](/icons/image2.gif) | CO-Centre SFS_2024-05-29-717x478.jpeg | 2024-05-29 21:16 | 56K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Tom Tynan Alumni of the Year winner 2015.jpg | 2024-01-13 21:47 | 57K | |
![[IMG]](/icons/image2.gif) | 124 HQ4A9657-694x552.JPG | 2024-11-22 14:11 | 57K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Irish Humanitarian Summit 2015.jpg | 2024-01-13 21:47 | 57K | |
![[IMG]](/icons/image2.gif) | HHH_AgTechUCD_Graphic_1_web-1-1.jpg | 2023-09-18 13:29 | 57K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_30_03_2020.pdf | 2023-09-18 13:29 | 57K | |
![[IMG]](/icons/image2.gif) | NutriGem Graph 3.png | 2023-09-18 13:29 | 57K | |
![[IMG]](/icons/image2.gif) | My Uni Life_Lyons Farm_UCD_Ep6 IMG2-1-705x470.jpg | 2024-02-12 15:18 | 57K | |
![[IMG]](/icons/image2.gif) | 2208_UCD-AFS-Teagasc_029a-750x426.jpg | 2024-01-13 21:47 | 58K | |
![[IMG]](/icons/image2.gif) | Crop_Sceiences_Grid.png | 2023-09-18 13:29 | 58K | |
![[IMG]](/icons/image2.gif) | SFI_Funding_2020_3-650x433.jpg | 2024-01-13 21:47 | 58K | |
![[IMG]](/icons/image2.gif) | kirstie 1-688x460.jpg | 2025-01-31 23:39 | 58K | |
![[IMG]](/icons/image2.gif) | registration.jpeg | 2024-01-13 20:17 | 58K | |
![[IMG]](/icons/image2.gif) | UCD-Athena-Swan-announcement--May-19-chairs.jpg | 2024-01-13 21:47 | 59K | |
![[IMG]](/icons/image2.gif) | fwat2022-650x404.jpg | 2024-01-13 21:47 | 59K | |
![[IMG]](/icons/image2.gif) | FDC Launch -650x433.jpg | 2024-01-13 21:47 | 59K | |
![[IMG]](/icons/image2.gif) | School_Awards_2019_Main-750x500.JPG | 2024-01-13 21:47 | 59K | |
![[IMG]](/icons/image2.gif) | Wildlife_Grid.png | 2023-09-18 13:29 | 59K | |
![[IMG]](/icons/image2.gif) | UCD SAFS with Minister-750x500.jpg | 2024-01-13 21:47 | 59K | |
![[IMG]](/icons/image2.gif) | Animal_Science_Web_Tile.png | 2023-09-18 13:29 | 60K | |
![[IMG]](/icons/image2.gif) | gibney5.png | 2023-12-14 13:16 | 60K | |
![[IMG]](/icons/image2.gif) | Agrimax_Grid.png | 2023-09-18 13:29 | 60K | |
![[IMG]](/icons/image2.gif) | Student Testimonial Grid.png | 2023-09-18 13:29 | 60K | |
![[IMG]](/icons/image2.gif) | HA_Web_Grid.png | 2023-09-18 13:29 | 60K | |
![[IMG]](/icons/image2.gif) | ASA_IFJ_Bursary_2020_desktop.jpg | 2024-01-13 21:47 | 60K | |
![[IMG]](/icons/image2.gif) | christopher cahill.jpg | 2024-09-25 22:14 | 60K | |
![[IMG]](/icons/image2.gif) | InsideGrid_RECM_option2.jpg | 2023-09-18 13:29 | 61K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Advances in Knowledge & Technologies for Agriculture Conference 2015.jpg | 2024-01-13 21:47 | 61K | |
![[IMG]](/icons/image2.gif) | MainContent_PlusvitalDec17.jpg | 2024-01-13 21:47 | 61K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes__13_04_2020.pdf | 2023-09-18 13:29 | 61K | |
![[IMG]](/icons/image2.gif) | AgSoc-raises-65k.jpg | 2024-01-13 21:47 | 62K | |
![[IMG]](/icons/image2.gif) | InsideGrid_FoodBusinessStrategy.jpg | 2023-09-18 13:29 | 62K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Prof John O'Doherty receives BSAS Award 2016.jpg | 2024-01-13 21:47 | 62K | |
![[IMG]](/icons/image2.gif) | FDC Scholars-650x433.jpg | 2024-01-13 21:47 | 62K | |
![[IMG]](/icons/image2.gif) | Main Content_news_John O'Doherty SFI funding 2015.jpg | 2024-01-13 21:47 | 62K | |
![[IMG]](/icons/image2.gif) | Main Content_news_ICRPS 2015.jpg | 2024-01-13 21:47 | 62K | |
![[IMG]](/icons/image2.gif) | Genomics_2018.jpg | 2024-01-13 21:47 | 63K | |
![[IMG]](/icons/image2.gif) | SUSPOLL_WEB_Grid.png | 2023-09-18 13:29 | 63K | |
![[IMG]](/icons/image2.gif) | Main Content_news_John Horgan Alumni of the Year winner 2016.jpg | 2023-09-18 13:29 | 64K | |
![[IMG]](/icons/image2.gif) | Conferring Image 2-750x402.jpg | 2024-01-13 21:47 | 64K | |
![[IMG]](/icons/image2.gif) | International_Cropped_EDI-751x413.jpg | 2023-09-18 13:29 | 65K | |
![[IMG]](/icons/image2.gif) | macra2.jpg | 2025-05-26 01:42 | 66K | |
![[IMG]](/icons/image2.gif) | fade-grid-right.svg | 2023-09-18 13:29 | 67K | |
![[IMG]](/icons/image2.gif) | Class pic Patrick-668x458.JPG | 2025-02-13 21:09 | 67K | |
![[IMG]](/icons/image2.gif) | Home3ColSpot_pre-vet.jpg | 2023-09-18 13:29 | 67K | |
![[IMG]](/icons/image2.gif) | Web_Headline_2.png | 2023-09-18 13:29 | 67K | |
![[IMG]](/icons/image2.gif) | IMG-20241101-WA0004-683x456.jpg | 2024-11-09 21:44 | 68K | |
![[IMG]](/icons/image2.gif) | ERM-_Web.png | 2023-09-18 13:29 | 68K | |
![[IMG]](/icons/image2.gif) | InsideGrid_HumanitarianAction.jpg | 2023-09-18 13:29 | 68K | |
![[IMG]](/icons/image2.gif) | fade-grid-left.svg | 2023-09-18 13:29 | 68K | |
![[IMG]](/icons/image2.gif) | 22-23_School_Awards_Ceremony_image4.jpg | 2023-09-18 13:29 | 68K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_17-08-20.pdf | 2023-09-18 13:29 | 69K | |
![[IMG]](/icons/image2.gif) | Group -702x468.jpg | 2024-07-15 15:45 | 69K | |
![[IMG]](/icons/image2.gif) | DSC_6375-692x461.JPG | 2024-10-31 15:47 | 69K | |
![[IMG]](/icons/image2.gif) | BioCrop.png | 2023-09-18 13:29 | 69K | |
![[IMG]](/icons/image2.gif) | Academic_Testimonials_panel_image.jpg | 2023-12-08 13:17 | 70K | |
![[IMG]](/icons/image2.gif) | Image 3-750x500.jpg | 2024-01-13 21:47 | 70K | |
![[IMG]](/icons/image2.gif) | Coillte-careers-7-scaled-697x514.jpeg | 2024-02-12 14:19 | 70K | |
![[IMG]](/icons/image2.gif) | Home3ColSpot_FBwC.jpg | 2023-09-18 13:29 | 70K | |
![[IMG]](/icons/image2.gif) | Screenshot 2023-10-06 at 12.05.56.png | 2024-01-13 21:47 | 71K | |
![[IMG]](/icons/image2.gif) | 01-eyeon.ie-404996-726x484.jpg | 2025-02-26 22:39 | 71K | |
![[IMG]](/icons/image2.gif) | unnamed (2)-647x485.jpg | 2024-03-22 11:52 | 71K | |
![[IMG]](/icons/image2.gif) | Project Team 1-750x500.jpg | 2024-01-13 21:47 | 71K | |
![[IMG]](/icons/image2.gif) | Group pic class of 24-674x403.jpg | 2024-02-29 20:47 | 71K | |
![[IMG]](/icons/image2.gif) | MainContent_BarbaraMurphyEIAward.jpg | 2024-01-13 21:47 | 71K | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-06-28 at 16.05.02-537x289.png | 2024-06-28 16:44 | 72K | |
![[IMG]](/icons/image2.gif) | Home3ColSpot_Research_7.jpg | 2023-09-18 13:29 | 72K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_26_10_20.pdf | 2023-09-18 13:29 | 73K | |
![[IMG]](/icons/image2.gif) | Small Group and Board-695x463.jpg | 2024-07-15 11:14 | 73K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Irish Agribusiness Awards 2016.jpg | 2023-09-18 13:29 | 73K | |
![[IMG]](/icons/image2.gif) | KP and AE-698x465.jpg | 2024-07-15 11:14 | 73K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Launch of Lyons Dairy Research and Education Facility 2016_1.jpg | 2024-01-13 21:47 | 74K | |
![[IMG]](/icons/image2.gif) | Home3ColSpot_LA&S.jpg | 2023-09-18 13:29 | 74K | |
![[IMG]](/icons/image2.gif) | Home3ColSpot_testimonials.jpg | 2023-09-18 13:29 | 74K | |
![[IMG]](/icons/image2.gif) | AgSoc 4-750x500.JPG | 2024-01-13 21:47 | 74K | |
![[IMG]](/icons/image2.gif) | 22-23_School_Awards_Ceremony_image3.jpg | 2024-01-13 21:47 | 74K | |
![[IMG]](/icons/image2.gif) | HaA_2017-1.jpg | 2024-01-11 16:17 | 74K | |
![[IMG]](/icons/image2.gif) | drmangan-603x754.jpeg | 2024-06-28 19:45 | 74K | |
![[IMG]](/icons/image2.gif) | 2406_AFS-FAO_011-704x564.jpg | 2024-06-10 12:45 | 74K | |
![[IMG]](/icons/image2.gif) | NutriGem Graph 4.png | 2023-09-18 13:29 | 75K | |
![[IMG]](/icons/image2.gif) | PHOTO THREE-750x443.JPG | 2024-01-13 21:47 | 75K | |
![[IMG]](/icons/image2.gif) | AgSoc 3-750x500.JPG | 2024-01-13 21:47 | 75K | |
![[IMG]](/icons/image2.gif) | 20240626-teagasc-197-738x492.jpg | 2024-06-28 13:45 | 76K | |
![[IMG]](/icons/image2.gif) | NutriGem Graph 1.png | 2023-09-18 13:29 | 76K | |
![[IMG]](/icons/image2.gif) | 22-23_School_Awards_Ceremony_image6.jpg | 2024-01-13 21:47 | 76K | |
![[IMG]](/icons/image2.gif) | 20230710_110057-660x495.jpg | 2024-11-09 21:44 | 76K | |
![[IMG]](/icons/image2.gif) | MainContent_FBCSLaunch.jpg | 2024-01-13 21:47 | 76K | |
![[IMG]](/icons/image2.gif) | MSC_0101-675x450.JPG | 2024-02-12 14:19 | 76K | |
![[IMG]](/icons/image2.gif) | FHI.jpg | 2023-09-18 13:29 | 76K | |
![[IMG]](/icons/image2.gif) | farm-accident©Rex.jpg | 2024-08-03 00:54 | 76K | |
![[IMG]](/icons/image2.gif) | storm ewoyn-713x401.jpg | 2025-02-21 17:39 | 76K | |
![[TXT]](/icons/text.gif) | bootstrap.bundle.min.js | 2023-11-20 18:25 | 76K | |
![[IMG]](/icons/image2.gif) | IMG-20240902-WA0014 copy-676x550.jpg | 2024-11-09 21:44 | 76K | |
![[ ]](/icons/unknown.gif) | Irish PACMAN PhD Advert.docx | 2025-02-21 16:39 | 76K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_09_11_20.pdf | 2023-09-18 13:29 | 77K | |
![[IMG]](/icons/image2.gif) | zoe nuffield-683x455.jpg | 2024-10-08 20:14 | 77K | |
![[IMG]](/icons/image2.gif) | bloom.jpg | 2024-01-13 21:47 | 77K | |
![[IMG]](/icons/image2.gif) | InsideGrid_Lyons Systems Dairy Herd.jpg | 2023-09-18 13:29 | 77K | |
![[IMG]](/icons/image2.gif) | 2406_AFS-FAO_024-701x561.jpg | 2024-06-10 12:45 | 78K | |
![[IMG]](/icons/image2.gif) | AgSoc 1-750x500.JPG | 2024-01-13 21:47 | 78K | |
![[IMG]](/icons/image2.gif) | kirstie 5-702x527.jpg | 2025-01-31 23:39 | 78K | |
![[IMG]](/icons/image2.gif) | MainContent_iot4f.jpg | 2024-01-13 21:47 | 78K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Farm Safety Forum 2016.jpg | 2024-01-13 21:47 | 79K | |
![[IMG]](/icons/image2.gif) | ImaGE 2a-750x702.jpg | 2024-01-13 21:47 | 79K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_14_09_20.pdf | 2023-09-18 13:29 | 79K | |
![[IMG]](/icons/image2.gif) | 22-23_School_Awards_Ceremony_image2.jpg | 2024-01-13 21:47 | 80K | |
![[IMG]](/icons/image2.gif) | fbd nuffield conference-650x649.jpg | 2024-10-08 20:14 | 82K | |
![[IMG]](/icons/image2.gif) | InsideGrid_NonStandard.jpg | 2023-09-18 13:29 | 82K | |
![[IMG]](/icons/image2.gif) | 2206_AgSoc_603a-750x600.jpg | 2024-01-13 21:47 | 82K | |
![[IMG]](/icons/image2.gif) | exams.jpeg | 2024-01-13 20:17 | 82K | |
![[ ]](/icons/unknown.gif) | la-brands-400-1.woff2 | 2023-09-18 13:29 | 83K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Knowledge Transfer conference 2015.jpg | 2024-01-13 21:47 | 83K | |
![[IMG]](/icons/image2.gif) | bios for website copy 8-210x335.png | 2023-12-12 01:44 | 83K | |
![[IMG]](/icons/image2.gif) | SoapboxScience_2022-750x598.jpg | 2024-01-13 21:47 | 83K | |
![[IMG]](/icons/image2.gif) | IMG_0284 (1)-687x542.jpg | 2024-11-19 13:13 | 83K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_19_10_20.pdf | 2023-09-18 13:29 | 84K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialImage_MaebhBrennan.jpg | 2023-09-18 13:29 | 84K | |
![[IMG]](/icons/image2.gif) | UCD AgFood EDI Promoting Gender Equality A4 FINAL_page-0001-751x531.jpg | 2023-09-18 13:29 | 85K | |
![[IMG]](/icons/image2.gif) | 3-20-210x336.png | 2025-06-16 01:44 | 85K | |
![[IMG]](/icons/image2.gif) | bios for website copy 2-210x336.png | 2023-12-12 01:44 | 86K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_02nd_July_2018.pdf | 2023-09-18 13:29 | 86K | |
![[TXT]](/icons/text.gif) | choices.min.js | 2023-11-20 18:25 | 86K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_27th_August_2018.pdf | 2023-09-18 13:29 | 87K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_23rd_July_2018.pdf | 2023-09-18 13:29 | 87K | |
![[IMG]](/icons/image2.gif) | student services.jpeg | 2024-01-13 20:17 | 87K | |
![[IMG]](/icons/image2.gif) | 22-23_School_Awards_Ceremony_image5.jpg | 2024-01-13 21:47 | 87K | |
![[IMG]](/icons/image2.gif) | FotoJet-6-scaled.jpg | 2024-03-01 18:19 | 88K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_20_07_2020.pdf | 2023-09-18 13:29 | 88K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Medium.woff2 | 2023-09-18 13:29 | 88K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_11th_June_2018.pdf | 2023-09-18 13:29 | 89K | |
![[IMG]](/icons/image2.gif) | Web_Podcast.jpg | 2023-09-18 13:29 | 89K | |
![[IMG]](/icons/image2.gif) | Home3ColSpot_studentexchange.jpg | 2023-09-18 13:29 | 89K | |
![[IMG]](/icons/image2.gif) | InsideGrid_FAM.jpg | 2023-09-18 13:29 | 89K | |
![[IMG]](/icons/image2.gif) | bios for website copy-210x335.png | 2023-12-12 01:44 | 89K | |
![[ ]](/icons/layout.gif) | 15-03-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 89K | |
![[IMG]](/icons/image2.gif) | 96w_Emmet_Jordan-Kelly.jpg | 2023-09-18 13:29 | 90K | |
![[ ]](/icons/layout.gif) | 19-07-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 90K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_09th_July_2018.pdf | 2023-09-18 13:29 | 90K | |
![[IMG]](/icons/image2.gif) | InsideGrid_FoodScience.jpg | 2023-09-18 13:29 | 90K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_17_03_2020.pdf | 2023-09-18 13:29 | 91K | |
![[IMG]](/icons/image2.gif) | bios for website copy 6-210x336.png | 2023-12-12 01:44 | 91K | |
![[IMG]](/icons/image2.gif) | IMG_5924-683x566.jpeg | 2024-05-31 10:46 | 91K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_14th_May_2018.pdf | 2023-09-18 13:29 | 91K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_01st_October_2018.pdf | 2023-09-18 13:29 | 91K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_27_07_2020.pdf | 2023-09-18 13:29 | 91K | |
![[IMG]](/icons/image2.gif) | MainContent_news_SocialFarming1.jpg | 2024-01-13 21:47 | 92K | |
![[ ]](/icons/unknown.gif) | Mc_Carrick_Award_Application_form.docx | 2024-01-13 21:47 | 92K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Harry Kehoe Honorary Conferring 2016.jpg | 2024-01-13 21:47 | 92K | |
![[IMG]](/icons/image2.gif) | InsideGrid_DBUS.jpg | 2023-09-18 13:29 | 92K | |
![[IMG]](/icons/image2.gif) | bios for website copy 4-210x335.png | 2023-12-12 01:44 | 93K | |
![[IMG]](/icons/image2.gif) | bios for website-210x335.png | 2023-12-12 01:44 | 93K | |
![[IMG]](/icons/image2.gif) | IMG_0298 use-700x597.jpg | 2024-11-19 13:13 | 94K | |
![[IMG]](/icons/image2.gif) | Home3ColSpot_studyabroad.jpg | 2023-09-18 13:29 | 94K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_07th_August_2018.pdf | 2023-09-18 13:29 | 94K | |
![[IMG]](/icons/image2.gif) | sheep 2-689x517.jpeg | 2025-02-01 00:39 | 94K | |
![[IMG]](/icons/image2.gif) | IMG_9883-765x569.jpg | 2024-11-01 18:17 | 94K | |
![[ ]](/icons/unknown.gif) | la-solid-900-1.woff2 | 2023-09-18 13:29 | 94K | |
![[IMG]](/icons/image2.gif) | InsideGrid_AgExtension.jpg | 2023-09-18 13:29 | 95K | |
![[IMG]](/icons/image2.gif) | Bloom_group.jpg | 2024-01-13 21:47 | 95K | |
![[IMG]](/icons/image2.gif) | InsideGrid_ANSC.jpg | 2023-09-18 13:29 | 95K | |
![[IMG]](/icons/image2.gif) | InsideGrid_AES.jpg | 2023-09-18 13:29 | 95K | |
![[IMG]](/icons/image2.gif) | 1622898-604893.jpg | 2025-02-24 13:39 | 95K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_19th_November_2018.pdf | 2023-09-18 13:29 | 95K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_08th_October_2018a.pdf | 2023-09-18 13:29 | 96K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_3rd_December_2018.pdf | 2023-09-18 13:29 | 96K | |
![[IMG]](/icons/image2.gif) | RTE's Damien O'Reilly with Helen Sheridan and Tommy Boland.jpg | 2024-01-13 21:47 | 96K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_26th_November_2018.pdf | 2023-09-18 13:29 | 96K | |
![[ ]](/icons/unknown.gif) | la-brands-400-1.woff | 2023-09-18 13:29 | 96K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_30th_October_2018.pdf | 2023-09-18 13:29 | 96K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_13th_August_2018.pdf | 2023-09-18 13:29 | 97K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_05th_November_2018.pdf | 2023-09-18 13:29 | 97K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Regular.woff2 | 2023-09-18 13:29 | 97K | |
![[IMG]](/icons/image2.gif) | farmers mental health3.jpeg | 2024-02-19 21:17 | 98K | |
![[ ]](/icons/layout.gif) | Weekly notes 30.09.24.pdf | 2024-10-04 13:15 | 99K | |
![[IMG]](/icons/image2.gif) | InsideGrid_schooloffice2.jpg | 2023-09-18 13:29 | 100K | |
![[IMG]](/icons/image2.gif) | SilverlogoAtheanSwanSchool-446x294.PNG | 2023-09-18 13:29 | 100K | |
![[IMG]](/icons/image2.gif) | grad8-588x784.jpg | 2024-06-28 15:45 | 101K | |
![[IMG]](/icons/image2.gif) | InsideGrid_EQS.jpg | 2023-09-18 13:29 | 101K | |
![[TXT]](/icons/text.gif) | fancybox.umd.js | 2023-09-18 13:29 | 101K | |
![[IMG]](/icons/image2.gif) | storm galway.jpeg | 2025-02-21 17:39 | 101K | |
![[ ]](/icons/layout.gif) | Weekly notes 14.10.24.pdf | 2024-10-17 19:16 | 101K | |
![[ ]](/icons/layout.gif) | Weekly notes 07.10.24.pdf | 2024-10-14 20:45 | 101K | |
![[IMG]](/icons/image2.gif) | InsideGrid_FBWCS.jpg | 2023-09-18 13:29 | 101K | |
![[IMG]](/icons/image2.gif) | InsideGrid_FoodRegAffairs.jpg | 2023-09-18 13:29 | 101K | |
![[IMG]](/icons/image2.gif) | MainContent_news_2018CareersDay2.jpg | 2024-01-13 21:47 | 102K | |
![[IMG]](/icons/image2.gif) | InsideGrid_progoffice.jpg | 2023-09-18 13:29 | 102K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialImage_BernardRyan.jpg | 2023-09-18 13:29 | 102K | |
![[ ]](/icons/layout.gif) | 27-09-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 103K | |
![[IMG]](/icons/image2.gif) | Agri extension.jpeg | 2024-03-01 18:19 | 104K | |
![[IMG]](/icons/image2.gif) | MainContent_news_SocialFarming2.jpg | 2024-01-13 21:47 | 104K | |
![[ ]](/icons/layout.gif) | 20-09-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 104K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialImage_MichelleORourke1.jpg | 2023-09-18 13:29 | 104K | |
![[IMG]](/icons/image2.gif) | InsideGrid_Forestry.jpg | 2023-09-18 13:29 | 105K | |
![[IMG]](/icons/image2.gif) | Smartgrass.jpg | 2023-09-18 13:29 | 106K | |
![[IMG]](/icons/image2.gif) | OReilly_night_002-750x233.gif | 2023-09-18 13:29 | 106K | |
![[IMG]](/icons/image2.gif) | unnamed-7.jpg | 2025-03-14 09:43 | 107K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_10th_September_2018.pdf | 2023-09-18 13:29 | 108K | |
![[IMG]](/icons/image2.gif) | InsideGrid_HNUT.jpg | 2023-09-18 13:29 | 109K | |
![[IMG]](/icons/image2.gif) | fees.png | 2024-01-13 20:17 | 110K | |
![[IMG]](/icons/image2.gif) | la-regular-400-1.svg | 2023-09-18 13:29 | 111K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_12th_March_2018.pdf | 2023-09-18 13:29 | 111K | |
![[ ]](/icons/layout.gif) | 05-04-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 112K | |
![[IMG]](/icons/image2.gif) | Vitamin_D_and_Bovine_TB_700x700.jpg | 2023-09-18 13:29 | 112K | |
![[ ]](/icons/layout.gif) | 30-08-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 113K | |
![[ ]](/icons/layout.gif) | 21-03-22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 116K | |
![[IMG]](/icons/image2.gif) | grad9-597x796.jpg | 2024-06-28 15:45 | 116K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_04_05_2020.pdf | 2023-09-18 13:29 | 116K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Medium.woff | 2023-09-18 13:29 | 116K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_03rd_September_2018.pdf | 2023-09-18 13:29 | 116K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_11_05_2020..pdf | 2023-09-18 13:29 | 117K | |
![[IMG]](/icons/image2.gif) | Main Content_2018AgriFoodDebate_UCD_winners.jpg | 2024-01-13 21:47 | 117K | |
![[ ]](/icons/layout.gif) | 06-09-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 117K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_01_06_2020.pdf | 2023-09-18 13:29 | 117K | |
![[ ]](/icons/layout.gif) | 13-09-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 117K | |
![[IMG]](/icons/image2.gif) | Countrywide_RTE_Pat_Lonergan-750x327.PNG | 2024-01-13 21:47 | 117K | |
![[IMG]](/icons/image2.gif) | InsideGrid_ACP.jpg | 2023-09-18 13:29 | 118K | |
![[IMG]](/icons/image2.gif) | Dara_Stanley_News_Website-215x215.png | 2024-01-13 21:47 | 118K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_07_09_20.pdf | 2023-09-18 13:29 | 118K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_16th_July_2018.pdf | 2023-09-18 13:29 | 118K | |
![[IMG]](/icons/image2.gif) | Main Content_news_School Student Awards 2016.jpg | 2023-09-18 13:29 | 119K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_24-08-20.pdf | 2023-09-18 13:29 | 119K | |
![[ ]](/icons/layout.gif) | 04-04-22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 120K | |
![[ ]](/icons/layout.gif) | 08-11-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 121K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_15th_October_2018.pdf | 2023-09-18 13:29 | 121K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_23_11_20.pdf | 2023-09-18 13:29 | 121K | |
![[IMG]](/icons/image2.gif) | MainContent_KTConference2017.jpg | 2024-01-13 21:47 | 121K | |
![[ ]](/icons/layout.gif) | 28-03-2022_ Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 122K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_16_06_2020.pdf | 2023-09-18 13:29 | 122K | |
![[IMG]](/icons/image2.gif) | ad astra fellows.jpeg | 2025-02-05 22:39 | 122K | |
![[ ]](/icons/unknown.gif) | la-solid-900-1.woff | 2023-09-18 13:29 | 122K | |
![[IMG]](/icons/image2.gif) | MainContent_2017SAFSAwards2.jpg | 2024-01-13 21:47 | 123K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_27_04_2020.pdf | 2023-09-18 13:29 | 123K | |
![[ ]](/icons/layout.gif) | 08-03-2022_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 123K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_08_06_2020.pdf | 2023-09-18 13:29 | 124K | |
![[ ]](/icons/layout.gif) | Weekly notes 18.11.24.pdf | 2024-11-25 14:13 | 125K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_31-08-20...pdf | 2023-09-18 13:29 | 125K | |
![[ ]](/icons/layout.gif) | Weekly notes 25.11.24.pdf | 2024-12-01 15:11 | 125K | |
![[ ]](/icons/layout.gif) | Weekly notes 21.10.24.pdf | 2024-11-02 14:46 | 126K | |
![[ ]](/icons/layout.gif) | 04-10-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 126K | |
![[ ]](/icons/unknown.gif) | MAIS_&_MAEI_WF_Application_Form_2019.docx | 2024-01-13 21:47 | 126K | |
![[ ]](/icons/layout.gif) | Weekly notes 28.10.24.pdf | 2024-11-02 14:46 | 126K | |
![[IMG]](/icons/image2.gif) | Women_in_Agriculutre_CERES_Event.jpg | 2023-09-18 13:29 | 126K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Regular.woff | 2023-09-18 13:29 | 126K | |
![[ ]](/icons/layout.gif) | Weekly notes 04.11.24.pdf | 2024-11-25 14:13 | 126K | |
![[ ]](/icons/layout.gif) | Weekly notes 11.11.24.pdf | 2024-11-25 14:13 | 126K | |
![[ ]](/icons/unknown.gif) | Poster_Abstract_Submission_form.docx | 2023-09-18 13:29 | 126K | |
![[ ]](/icons/layout.gif) | Weekly notes 02.12.24.pdf | 2024-12-11 10:42 | 127K | |
![[ ]](/icons/layout.gif) | 19-04-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 127K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Owen Brennan Honorary Conferring 2015.jpg | 2024-01-13 21:47 | 127K | |
![[IMG]](/icons/image2.gif) | shane cows-650x854.jpg | 2024-10-29 20:16 | 128K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_21_09_20.pdf | 2023-09-18 13:29 | 128K | |
![[IMG]](/icons/image2.gif) | fieldofyellowflowers.jpg | 2023-09-18 13:29 | 129K | |
![[IMG]](/icons/image2.gif) | DG china.jpeg | 2024-06-13 12:44 | 129K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Launch of Agri Food Strategy group Synthesis report 2015.jpg | 2024-01-13 21:47 | 130K | |
![[IMG]](/icons/image2.gif) | InsideGrid_HLSM.jpg | 2023-09-18 13:29 | 130K | |
![[ ]](/icons/layout.gif) | 15-11-2021 Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 131K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_05th_March_2018.pdf | 2023-09-18 13:29 | 131K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_05_10_20.pdf | 2023-09-18 13:29 | 131K | |
![[ ]](/icons/layout.gif) | 18-10-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 132K | |
![[IMG]](/icons/image2.gif) | InsideGrid_myUCD.jpg | 2023-09-18 13:29 | 132K | |
![[IMG]](/icons/image2.gif) | Morning_Ireland_07.04-750x352.PNG | 2024-01-13 21:47 | 132K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_02_11_20.pdf | 2023-09-18 13:29 | 133K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_03-08-20.pdf | 2023-09-18 13:29 | 133K | |
![[IMG]](/icons/image2.gif) | Frank_Web_News.png | 2024-01-13 21:47 | 133K | |
![[ ]](/icons/layout.gif) | 14-03-22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 133K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_25th_June_2018.pdf | 2023-09-18 13:29 | 134K | |
![[ ]](/icons/layout.gif) | 25-04-2022_ Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 134K | |
![[ ]](/icons/layout.gif) | 25-10-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 135K | |
![[IMG]](/icons/image2.gif) | john roche.jpeg | 2025-05-08 11:43 | 135K | |
![[ ]](/icons/layout.gif) | 02-05-22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 136K | |
![[IMG]](/icons/image2.gif) | Agri extension-1.jpeg | 2024-03-23 17:48 | 137K | |
![[IMG]](/icons/image2.gif) | knowledge transfer.jpeg | 2025-04-09 16:42 | 137K | |
![[ ]](/icons/layout.gif) | 22-11-2021 Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 138K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_29_06_2020.pdf | 2023-09-18 13:29 | 138K | |
![[ ]](/icons/layout.gif) | 18-04-2022_ Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 138K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_28_09_20.pdf | 2023-09-18 13:29 | 139K | |
![[IMG]](/icons/image2.gif) | Main Content_LSAS1.jpg | 2023-09-18 13:29 | 139K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_16_11_20.pdf | 2023-09-18 13:29 | 139K | |
![[ ]](/icons/layout.gif) | 12-04-2021 Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 140K | |
![[IMG]](/icons/image2.gif) | MainContent_news_2018CareersDay1.jpg | 2024-01-13 21:47 | 141K | |
![[IMG]](/icons/image2.gif) | Main Content_news_School Student Awards 2015.jpg | 2024-01-13 21:47 | 141K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialImage_JoanneOKeeffe.jpg | 2023-09-18 13:29 | 141K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_20_04_2020.pdf | 2023-09-18 13:29 | 142K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_17th_September_2018.pdf | 2023-09-18 13:29 | 142K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_13_07_2020.pdf | 2023-09-18 13:29 | 143K | |
![[TXT]](/icons/text.gif) | swiper-bundle.min.js | 2023-09-18 13:29 | 143K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_30th_April_2018.pdf | 2023-09-18 13:29 | 143K | |
![[IMG]](/icons/image2.gif) | MainContent_UCDMacraSkillnet.jpg | 2024-01-13 21:47 | 143K | |
![[IMG]](/icons/image2.gif) | InsideGrid_AST.jpg | 2023-09-18 13:29 | 144K | |
![[IMG]](/icons/image2.gif) | Teagasc-UCD-Knowledge-Transfer-Conference-2024-1.jpeg | 2024-11-01 11:47 | 144K | |
![[IMG]](/icons/image2.gif) | food science nutrition.png | 2025-05-06 22:12 | 145K | |
![[IMG]](/icons/image2.gif) | InsidePanelWithImage_About_Option3.jpg | 2023-09-18 13:29 | 145K | |
![[ ]](/icons/layout.gif) | 06-12-21 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 146K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_30th_July_2018.pdf | 2023-09-18 13:29 | 146K | |
![[IMG]](/icons/image2.gif) | hourses.jpeg | 2024-02-19 00:17 | 147K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Careers Day 2017.jpg | 2023-09-18 13:29 | 147K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_10th_December_2018.pdf | 2023-09-18 13:29 | 148K | |
![[IMG]](/icons/image2.gif) | MainContent_DAFMAwardsJul2018.jpg | 2024-01-13 21:47 | 148K | |
![[IMG]](/icons/image2.gif) | mairead4.jpg | 2024-09-24 22:44 | 148K | |
![[IMG]](/icons/image2.gif) | FOOD-I_and_the_Food_Shield_project.jpg | 2024-01-13 21:47 | 148K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_22nd_October_2018.pdf | 2023-09-18 13:29 | 148K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_20th_August_2018.pdf | 2023-09-18 13:29 | 148K | |
![[IMG]](/icons/image2.gif) | InsideGrid_Omnibus.jpg | 2023-09-18 13:29 | 148K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_12th_November_2018.pdf | 2023-09-18 13:29 | 148K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_06_07_2020.pdf | 2023-09-18 13:29 | 149K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Great Agri-Food Debate 2017.jpg | 2023-09-18 13:29 | 149K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_30_11_20.pdf | 2023-09-18 13:29 | 149K | |
![[IMG]](/icons/image2.gif) | staff.png | 2024-01-13 20:17 | 150K | |
![[IMG]](/icons/image2.gif) | Main Content_news_UCD Teagasc Knowledge Transfer Conference 2016.jpg | 2024-01-13 21:47 | 151K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_18th_Sep_2017.pdf | 2023-09-18 13:29 | 151K | |
![[IMG]](/icons/image2.gif) | IMG_5836-645x1147.jpeg | 2024-05-31 10:46 | 151K | |
![[ ]](/icons/layout.gif) | 08-03-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 152K | |
![[ ]](/icons/layout.gif) | 26-07-21.Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 152K | |
![[IMG]](/icons/image2.gif) | bioag.jpeg | 2024-04-19 16:45 | 152K | |
![[IMG]](/icons/image2.gif) | aoife feeney 2.jpeg | 2024-06-18 12:14 | 152K | |
![[ ]](/icons/unknown.gif) | la-brands-400-1.ttf | 2023-09-18 13:29 | 152K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_22_06_2020.pdf | 2023-09-18 13:29 | 153K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_28th_May_2018.pdf | 2023-09-18 13:29 | 153K | |
![[ ]](/icons/unknown.gif) | la-brands-400-1.eot | 2023-09-18 13:29 | 153K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_18th_Dec_2017.pdf | 2023-09-18 13:29 | 154K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialImage_DavidODwyer.jpg | 2023-09-18 13:29 | 154K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_21st_May_2018.pdf | 2023-09-18 13:29 | 155K | |
![[ ]](/icons/layout.gif) | 26-04-2021 Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 156K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialImage_CathyDonoghue1.jpg | 2023-09-18 13:29 | 156K | |
![[IMG]](/icons/image2.gif) | InsideGrid_Food4Me.jpg | 2023-09-18 13:29 | 157K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_08th_May_2018.pdf | 2023-09-18 13:29 | 158K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_18th_June_2018.pdf | 2023-09-18 13:29 | 158K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_5th_June_2018.pdf | 2023-09-18 13:29 | 158K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_18_05_2020..pdf | 2023-09-18 13:29 | 159K | |
![[ ]](/icons/layout.gif) | 17-05-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 159K | |
![[ ]](/icons/layout.gif) | Monitor Farms and Tillage farms.pdf | 2024-01-13 21:47 | 159K | |
![[ ]](/icons/layout.gif) | 9. Part time farmers engagement with advisory services and how it can be improved.pdf | 2024-01-13 21:47 | 159K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_26th_March_2018.pdf | 2023-09-18 13:29 | 159K | |
![[ ]](/icons/layout.gif) | 8. Advisors use of technology.pdf | 2024-03-23 17:48 | 160K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_25_05_2020.pdf | 2023-09-18 13:29 | 160K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_26_03_2020.pdf | 2023-09-18 13:29 | 161K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_19th_March_2018.pdf | 2023-09-18 13:29 | 162K | |
![[IMG]](/icons/image2.gif) | InsidePanelWithImage_Option2.jpg | 2023-09-18 13:29 | 163K | |
![[ ]](/icons/layout.gif) | 03-05-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 163K | |
![[ ]](/icons/layout.gif) | 10-05-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 163K | |
![[ ]](/icons/layout.gif) | 6. Engaging farmers in conversations about climate change.pdf | 2024-01-13 21:47 | 165K | |
![[ ]](/icons/layout.gif) | 11-10-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 166K | |
![[IMG]](/icons/image2.gif) | Careers_Day_1.jpg | 2023-09-18 13:29 | 166K | |
![[IMG]](/icons/image2.gif) | Fullbright group shop.jpg | 2024-01-13 21:47 | 167K | |
![[ ]](/icons/layout.gif) | 6. Supporting Diversity of Learners in Teagasc Education.pdf | 2024-01-13 21:47 | 168K | |
![[IMG]](/icons/image2.gif) | InsidePanelWithImage_Study_Option1.jpg | 2023-09-18 13:29 | 168K | |
![[ ]](/icons/layout.gif) | 31-05-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 168K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_07_12_20.pdf | 2023-09-18 13:29 | 169K | |
![[ ]](/icons/layout.gif) | 8. Grass Visual Evaluation of Soil Structure (VESS) method as a visual KT tool.pdf | 2024-01-13 21:47 | 169K | |
![[IMG]](/icons/image2.gif) | Main Content_Earth worm research.jpg | 2023-09-18 13:29 | 169K | |
![[ ]](/icons/layout.gif) | 3. Comeragh Mountains Upland Farming .pdf | 2024-01-13 21:47 | 170K | |
![[ ]](/icons/layout.gif) | 09-05-22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 170K | |
![[ ]](/icons/layout.gif) | 5. An intervention study to increase the area sown in catch crops as a mitigation strategy in a catchment with high stream water concentrations of nitrate N..pdf | 2024-01-13 21:47 | 170K | |
![[ ]](/icons/layout.gif) | 7. Farmer lead identification of barriers and solutions to the adoption of clover on dairy farms.pdf | 2024-01-13 21:47 | 170K | |
![[ ]](/icons/layout.gif) | Model for evaluation of signpost events.pdf | 2024-01-13 21:47 | 171K | |
![[ ]](/icons/layout.gif) | 3. Competency framework to support a life-long learning programme for farmers..pdf | 2024-03-23 17:48 | 171K | |
![[ ]](/icons/layout.gif) | 29-11-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 172K | |
![[ ]](/icons/layout.gif) | 22-03-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 173K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Farm Walk & Talk 2017.jpg | 2023-09-18 13:29 | 173K | |
![[ ]](/icons/layout.gif) | 10. Knowledge sharing of Continuous Cover Forestry management systems through eLearning.pdf | 2024-01-13 21:47 | 174K | |
![[ ]](/icons/layout.gif) | 310323 Final.pdf | 2023-09-18 13:29 | 175K | |
![[ ]](/icons/layout.gif) | 4. Succession and Inheritance project teams.pdf | 2024-01-13 21:47 | 175K | |
![[ ]](/icons/layout.gif) | 01-08-22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 175K | |
![[ ]](/icons/layout.gif) | Weekly Notes 02.06.2025 (2).pdf | 2025-06-06 10:42 | 175K | |
![[ ]](/icons/layout.gif) | Weekly notes 19.05.25.pdf | 2025-05-24 08:42 | 175K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_12_10_20.pdf | 2023-09-18 13:29 | 176K | |
![[IMG]](/icons/image2.gif) | donal o'neill camida copy.jpg | 2024-10-30 00:16 | 176K | |
![[ ]](/icons/layout.gif) | 31-10-22.pdf | 2023-09-18 13:29 | 176K | |
![[ ]](/icons/layout.gif) | 4. Farm safety interventions to help advisers promote livestock safety.pdf | 2024-03-23 17:48 | 176K | |
![[ ]](/icons/layout.gif) | Weekly notes 25324.pdf | 2024-04-15 17:46 | 177K | |
![[IMG]](/icons/image2.gif) | sean molloy.jpg | 2024-01-27 01:17 | 177K | |
![[IMG]](/icons/image2.gif) | Main Content_Innovation & Impact.jpg | 2024-01-13 21:47 | 177K | |
![[ ]](/icons/layout.gif) | 2. A KT toolkit to improve fertiliser spreading on grassland farms.pdf | 2024-01-13 21:47 | 177K | |
![[ ]](/icons/layout.gif) | 11-07-22_Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 178K | |
![[IMG]](/icons/image2.gif) | pattern-white.svg | 2023-09-18 13:29 | 178K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_10-08-20.pdf | 2023-09-18 13:29 | 178K | |
![[ ]](/icons/layout.gif) | 7_11_22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 179K | |
![[IMG]](/icons/image2.gif) | citizenrural.jpeg | 2024-04-28 17:46 | 179K | |
![[ ]](/icons/layout.gif) | 5. Farm safety interventions to help advisers promote safety with livestock.pdf | 2024-01-13 21:47 | 179K | |
![[IMG]](/icons/image2.gif) | Projects.png | 2023-09-18 13:29 | 179K | |
![[ ]](/icons/layout.gif) | 12. Knowledge sharing of Continuous Cover Forestry (CCF) management systems through eLearning, interactive in-forest KT formats and new digital tools .pdf | 2024-01-13 21:47 | 179K | |
![[ ]](/icons/layout.gif) | 5. UDL for teaching and learning.pdf | 2024-03-23 17:48 | 180K | |
![[IMG]](/icons/image2.gif) | Website_HomeSlider_desktop-750x358.png | 2024-01-13 21:47 | 180K | |
![[ ]](/icons/layout.gif) | Management of Riparian Buffer Zones.pdf | 2024-01-13 21:47 | 180K | |
![[ ]](/icons/layout.gif) | 18-07-22_Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 180K | |
![[IMG]](/icons/image2.gif) | suspoll dara.jpeg | 2024-04-03 11:16 | 180K | |
![[ ]](/icons/layout.gif) | Cocreating diversity and inclusion training.pdf | 2024-01-13 21:47 | 182K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_26th_June_2017.pdf | 2023-09-18 13:29 | 182K | |
![[ ]](/icons/layout.gif) | 3. Evaluation of a pedagogical competency framework in the design and delivery of training for Teagasc Education Staff .pdf | 2024-01-13 21:47 | 182K | |
![[ ]](/icons/layout.gif) | 13. Assessment of a sustainable innovation support model for smallholder dairy farmers in Kenya.pdf | 2024-01-13 21:47 | 183K | |
![[IMG]](/icons/image2.gif) | UCDConwayFestival_Medal_HR_JOG-1.jpg | 2023-09-18 13:29 | 183K | |
![[ ]](/icons/layout.gif) | Weekly notes 09.12.2024.pdf | 2024-12-18 20:11 | 183K | |
![[ ]](/icons/layout.gif) | 03-08-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 184K | |
![[IMG]](/icons/image2.gif) | Main Content_news_AST Degree launch.jpg | 2023-09-18 13:29 | 185K | |
![[ ]](/icons/layout.gif) | 12-07-21 Lyons Systems Research Herd Notes...pdf | 2023-09-18 13:29 | 185K | |
![[ ]](/icons/layout.gif) | 17-10-22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 185K | |
![[ ]](/icons/layout.gif) | 1. A multi-actor, local approach to increasing lime usage on Irish farms.pdf | 2024-01-13 21:47 | 186K | |
![[ ]](/icons/layout.gif) | 24-10-22.pdf | 2023-09-18 13:29 | 186K | |
![[IMG]](/icons/image2.gif) | MainContent_2017SAFSAwards1.jpg | 2024-01-13 21:47 | 187K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Big Sata symposium 2016.jpg | 2023-09-18 13:29 | 188K | |
![[IMG]](/icons/image2.gif) | new international image copy-1.jpeg | 2024-10-14 11:46 | 188K | |
![[IMG]](/icons/image2.gif) | KT Conference 2018.jpg | 2024-01-13 21:47 | 189K | |
![[ ]](/icons/layout.gif) | 14-06-2021 Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 190K | |
![[IMG]](/icons/image2.gif) | MainContent_StockjudingCompApr18.jpg | 2024-01-13 21:47 | 191K | |
![[ ]](/icons/layout.gif) | Multi-actor approach to herd health.pdf | 2024-01-13 21:47 | 191K | |
![[ ]](/icons/layout.gif) | 14_11_22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 191K | |
![[ ]](/icons/layout.gif) | 04-07-22_Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 192K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_24th_April_2017.pdf | 2023-09-18 13:29 | 192K | |
![[ ]](/icons/layout.gif) | 05-07-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 193K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_22nd_May_2017.pdf | 2023-09-18 13:29 | 193K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Great Agri Food Debate 2016_2.jpg | 2024-01-13 21:47 | 193K | |
![[IMG]](/icons/image2.gif) | grid-darken.svg | 2023-11-20 18:25 | 194K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_2nd_April_2018.pdf | 2023-09-18 13:29 | 195K | |
![[IMG]](/icons/image2.gif) | UCD-AgandFood-Rethinking-the-Food-Systems-web-page-banner-750x200.png | 2023-09-18 13:29 | 196K | |
![[ ]](/icons/layout.gif) | 080523.pdf | 2023-09-18 13:29 | 196K | |
![[ ]](/icons/layout.gif) | Extension and training for organic farms.pdf | 2024-01-13 21:47 | 196K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_18th_April_2017.pdf | 2023-09-18 13:29 | 196K | |
![[ ]](/icons/layout.gif) | 01-03-2021 Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 197K | |
![[IMG]](/icons/image2.gif) | FINAL Tara Dirilgen-650x366.png | 2024-01-13 21:47 | 197K | |
![[ ]](/icons/layout.gif) | 20-06-22_Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 197K | |
![[ ]](/icons/layout.gif) | 120623.pdf | 2023-09-18 13:29 | 197K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialimage_MagdalenaSpitzer.jpg | 2023-09-18 13:29 | 197K | |
![[ ]](/icons/layout.gif) | 150523.pdf | 2023-09-18 13:29 | 197K | |
![[ ]](/icons/layout.gif) | 220523.pdf | 2023-09-18 13:29 | 197K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_09_03_2020.pdf | 2023-09-18 13:29 | 198K | |
![[ ]](/icons/layout.gif) | 30-05-22_Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 198K | |
![[ ]](/icons/layout.gif) | Weekly notes 21.04.25.pdf | 2025-05-02 16:12 | 198K | |
![[ ]](/icons/layout.gif) | 010523.pdf | 2023-09-18 13:29 | 198K | |
![[ ]](/icons/layout.gif) | 290523.pdf | 2023-09-18 13:29 | 198K | |
![[ ]](/icons/layout.gif) | 27-06-22_Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 198K | |
![[ ]](/icons/layout.gif) | 060623.pdf | 2023-09-18 13:29 | 199K | |
![[ ]](/icons/layout.gif) | Weekly notes 03.03.25.pdf | 2025-03-10 13:12 | 199K | |
![[ ]](/icons/layout.gif) | 8. Advisory Strategy for improved milk solids.pdf | 2025-04-09 16:42 | 199K | |
![[ ]](/icons/layout.gif) | 190623.pdf | 2023-09-18 13:29 | 199K | |
![[ ]](/icons/layout.gif) | Weekly notes 5.05.25..pdf | 2025-05-24 08:42 | 199K | |
![[ ]](/icons/layout.gif) | 260623.pdf | 2023-09-18 13:29 | 200K | |
![[ ]](/icons/layout.gif) | Weekly notes 17.03.25 .pdf | 2025-03-25 14:12 | 200K | |
![[ ]](/icons/layout.gif) | 28-06-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 200K | |
![[ ]](/icons/layout.gif) | 13-10-22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 200K | |
![[ ]](/icons/layout.gif) | 07-06-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 200K | |
![[IMG]](/icons/image2.gif) | Screenshot 2025-02-05 at 16.13.39-463x526.png | 2025-02-05 21:39 | 201K | |
![[IMG]](/icons/image2.gif) | InsideBannermobile_Study.jpg | 2023-09-18 13:29 | 201K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Agri Aware Patron 3.jpg | 2023-09-18 13:29 | 202K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_24th_July_2017.pdf | 2023-09-18 13:29 | 202K | |
![[ ]](/icons/layout.gif) | Weekly notes 24.03.25.pdf | 2025-04-06 17:12 | 202K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_10th_July_2017.pdf | 2023-09-18 13:29 | 202K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_10th_April_2017.pdf | 2023-09-18 13:29 | 203K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_8th_May_2017.pdf | 2023-09-18 13:29 | 203K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_25th_Sep_2017.pdf | 2023-09-18 13:29 | 204K | |
![[ ]](/icons/layout.gif) | Weekly notes 24.02.2025.pdf | 2025-03-03 10:42 | 204K | |
![[ ]](/icons/layout.gif) | Weekly notes 12.05.2025.pdf | 2025-05-24 08:42 | 204K | |
![[ ]](/icons/layout.gif) | Weekly notes 7.04.25.pdf | 2025-04-24 20:12 | 205K | |
![[ ]](/icons/layout.gif) | Weekly notes 31.03.2025.pdf | 2025-04-24 20:12 | 205K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_31st_July_2017.pdf | 2023-09-18 13:29 | 205K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_11th_Sep_2017.pdf | 2023-09-18 13:29 | 205K | |
![[ ]](/icons/layout.gif) | Weekly notes 14.04.25.pdf | 2025-04-24 20:12 | 206K | |
![[ ]](/icons/layout.gif) | Weekly notes 28.04.25.pdf | 2025-05-02 16:12 | 206K | |
![[ ]](/icons/layout.gif) | 13-06-22_Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 206K | |
![[IMG]](/icons/image2.gif) | pigs.jpeg | 2024-01-23 14:18 | 206K | |
![[IMG]](/icons/image2.gif) | hero-1.png | 2023-09-18 13:29 | 206K | |
![[ ]](/icons/layout.gif) | Weekly notes 10.03.25.pdf | 2025-03-25 14:12 | 207K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_03rd_July_2017.pdf | 2023-09-18 13:29 | 207K | |
![[ ]](/icons/layout.gif) | Weekly Notes 26.05.2025.pdf | 2025-06-06 10:42 | 207K | |
![[IMG]](/icons/image2.gif) | careers day pic (1).jpeg | 2024-01-11 16:17 | 209K | |
![[IMG]](/icons/image2.gif) | MainContent_news_HSIEquineReportLaunch2017.jpg | 2024-01-13 21:47 | 211K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_02nd_Oct_2017.pdf | 2023-09-18 13:29 | 211K | |
![[ ]](/icons/layout.gif) | 21-06-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 212K | |
![[IMG]](/icons/image2.gif) | MainContent_UCDvisitUNIF1.jpg | 2024-01-13 21:47 | 212K | |
![[IMG]](/icons/image2.gif) | Main Content_SSSI.jpg | 2024-01-13 21:47 | 213K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_23rd_Oct_2017.pdf | 2023-09-18 13:29 | 213K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_2nd_May_2017.pdf | 2023-09-18 13:29 | 213K | |
![[IMG]](/icons/image2.gif) | MainContent_UCDvisitUNIF2.jpg | 2024-01-13 21:47 | 214K | |
![[ ]](/icons/layout.gif) | 11. Attitudes and behaviours towards agri data .pdf | 2025-04-09 16:42 | 215K | |
![[ ]](/icons/layout.gif) | 1. Generative AI in design of learning assessments.pdf | 2025-04-09 16:42 | 215K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialImage_TaraWestington.jpg | 2023-09-18 13:29 | 216K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_17th_July_2017.pdf | 2023-09-18 13:29 | 216K | |
![[IMG]](/icons/image2.gif) | MainContent_BMurphy_Equilume.jpg | 2024-01-13 21:47 | 217K | |
![[IMG]](/icons/image2.gif) | edi2.jpeg | 2024-01-13 22:47 | 217K | |
![[ ]](/icons/layout.gif) | 19_09_22.pdf | 2023-09-18 13:29 | 217K | |
![[ ]](/icons/layout.gif) | 2. Education for ecosystem services in upland areas.pdf | 2025-04-09 16:42 | 217K | |
![[ ]](/icons/layout.gif) | 10. KT support for distribution of Anaerobic Digestor organic manures KMG.pdf | 2025-04-09 16:42 | 217K | |
![[ ]](/icons/layout.gif) | 06-06-22_Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 217K | |
![[ ]](/icons/layout.gif) | 16-05-22_Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 219K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialimage_SarahMoyer.jpg | 2023-09-18 13:29 | 219K | |
![[ ]](/icons/layout.gif) | 26_09_22.pdf | 2023-09-18 13:29 | 219K | |
![[ ]](/icons/layout.gif) | 23-05-22_Lyons Systems Research Herd Notes..pdf | 2023-09-18 13:29 | 220K | |
![[IMG]](/icons/image2.gif) | updated panels-220x500.png | 2023-12-12 13:47 | 220K | |
![[ ]](/icons/unknown.gif) | la-solid-900-1.ttf | 2023-09-18 13:29 | 221K | |
![[ ]](/icons/unknown.gif) | la-solid-900-1.eot | 2023-09-18 13:29 | 221K | |
![[ ]](/icons/layout.gif) | 4. KT support for distribution of pig and poultry manures.pdf | 2025-04-09 16:42 | 223K | |
![[ ]](/icons/layout.gif) | 5. Integration of environmental messages and technical advice.pdf | 2025-04-09 16:42 | 223K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_24th_September_2018.pdf | 2023-09-18 13:29 | 223K | |
![[ ]](/icons/layout.gif) | 9. Grassland management practices on Irish organic livestock farms.pdf | 2025-04-09 16:42 | 224K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_31st_Oct_2017.pdf | 2023-09-18 13:29 | 224K | |
![[ ]](/icons/layout.gif) | 24-05-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 225K | |
![[IMG]](/icons/image2.gif) | MainContent_SoFABConference2018.jpg | 2024-01-13 21:47 | 225K | |
![[ ]](/icons/layout.gif) | 6. Services for Farmers' diversification needs.pdf | 2025-04-09 16:42 | 225K | |
![[ ]](/icons/layout.gif) | 1. Signpost - selection and adoption of env friendly practices.pdf | 2024-03-23 17:48 | 226K | |
![[IMG]](/icons/image2.gif) | Main Content_news_AgSoc 2017.jpg | 2023-09-18 13:29 | 226K | |
![[ ]](/icons/layout.gif) | 3. Key Skills for farmers through lifelong learning.pdf | 2025-04-09 16:42 | 226K | |
![[IMG]](/icons/image2.gif) | Add a subheading copy-220x500.png | 2023-12-12 13:47 | 227K | |
![[ ]](/icons/layout.gif) | 7. Impact of demonstrations on farmer behaviour in climate action.pdf | 2025-04-09 16:42 | 229K | |
![[IMG]](/icons/image2.gif) | updated panels copy-220x500.png | 2023-12-12 13:47 | 229K | |
![[IMG]](/icons/image2.gif) | Add a subheading-220x500.png | 2023-12-12 13:47 | 230K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialimage_MorganWinder.jpg | 2023-09-18 13:29 | 230K | |
![[ ]](/icons/layout.gif) | 08-08-22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 231K | |
![[IMG]](/icons/image2.gif) | new international image copy.jpeg | 2024-02-29 21:48 | 232K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_20th_Nov_2017.pdf | 2023-09-18 13:29 | 233K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_05th_June_2017.pdf | 2023-09-18 13:29 | 233K | |
![[IMG]](/icons/image2.gif) | Main Content_news_Auroch Genome Research 2015_1.jpg | 2024-01-13 21:47 | 235K | |
![[ ]](/icons/layout.gif) | 29-03-2021.pdf | 2023-09-18 13:29 | 235K | |
![[IMG]](/icons/image2.gif) | grid-overlay-footer.png | 2023-09-18 13:29 | 240K | |
![[IMG]](/icons/image2.gif) | MainContent_BrexitSpeakers.jpg | 2024-01-13 21:47 | 243K | |
![[ ]](/icons/layout.gif) | 2. Evaluation of Online Learning Strategies for the new Horticulture apprenticeships in Sportsturf and Applied Horticulture.pdf | 2024-01-13 21:47 | 243K | |
![[ ]](/icons/layout.gif) | 01-11-2021 Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 245K | |
![[ ]](/icons/layout.gif) | Evaluation of online strategies for new hort apprents.pdf | 2024-01-13 21:47 | 246K | |
![[IMG]](/icons/image2.gif) | Careers_150.jpg | 2024-01-13 21:47 | 246K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_06th_Nov_2017.pdf | 2023-09-18 13:29 | 246K | |
![[IMG]](/icons/image2.gif) | ear to the ground.jpeg | 2024-10-30 20:45 | 246K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialimage_KelleyDeLacey.jpg | 2023-09-18 13:29 | 251K | |
![[ ]](/icons/layout.gif) | Dr. Barry McMahon_Could-rethinking-predator-management-protect-europes-ground-nesting-birds.pdf | 2024-01-13 21:47 | 251K | |
![[IMG]](/icons/image2.gif) | WorkLifeBalance_P1_V2.jpg | 2023-09-18 13:29 | 253K | |
![[ ]](/icons/unknown.gif) | 11-04-2022_ Lyons Systems Research Herd Notes | 2023-09-18 13:29 | 254K | |
![[ ]](/icons/layout.gif) | Walsh Scholarship Knowledge Transfer Programmes 2021.pdf | 2024-01-13 21:47 | 256K | |
![[IMG]](/icons/image2.gif) | 1983 Class reunion - Original class.jpg | 2024-01-13 21:47 | 258K | |
![[ ]](/icons/layout.gif) | 7. Technology sharing arrangements in HNV farming.pdf | 2024-03-23 17:48 | 259K | |
![[IMG]](/icons/image2.gif) | InsideBannermobile_GTProgrammes.jpg | 2023-09-18 13:29 | 259K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialimage_RachelHeckle.jpg | 2023-09-18 13:29 | 259K | |
![[ ]](/icons/unknown.gif) | 170423 ES.docx | 2023-09-18 13:29 | 260K | |
![[ ]](/icons/unknown.gif) | 100423-.docx | 2023-09-18 13:29 | 260K | |
![[ ]](/icons/unknown.gif) | 060423 final.docx | 2023-09-18 13:29 | 260K | |
![[ ]](/icons/layout.gif) | 28-02-22_Lyons Systems Research Herd Notes.pdf | 2023-09-18 13:29 | 262K | |
![[ ]](/icons/unknown.gif) | 240423 -.docx | 2023-09-18 13:29 | 262K | |
![[ ]](/icons/layout.gif) | 2. Enhancing Water Quality Management in Agricultural Landscapes.pdf | 2024-03-23 17:48 | 262K | |
![[ ]](/icons/unknown.gif) | 030723.docx | 2023-09-18 13:29 | 264K | |
![[ ]](/icons/unknown.gif) | 100723.docx | 2023-09-18 13:29 | 264K | |
![[ ]](/icons/layout.gif) | 6. Locally led cooperation between livestock and tillage farming systems.pdf | 2024-03-23 17:48 | 264K | |
![[ ]](/icons/layout.gif) | Flyer_spread.pdf | 2024-01-13 21:47 | 264K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_12th_June_2017.pdf | 2023-09-18 13:29 | 267K | |
![[IMG]](/icons/image2.gif) | 1983 Class reunion - group at curragh racecourse.jpg | 2023-10-05 09:48 | 271K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_27th_March_2017.pdf | 2023-09-18 13:29 | 271K | |
![[IMG]](/icons/image2.gif) | mairead and frank.jpg | 2024-09-24 22:44 | 272K | |
![[IMG]](/icons/image2.gif) | Careers_115.jpg | 2024-01-13 21:47 | 276K | |
![[ ]](/icons/layout.gif) | Supporting Students with Disabilities in UCD, Julie Tonge, Disability Officer, UCD Access & Lifelong Learning.pdf | 2023-09-18 13:29 | 281K | |
![[ ]](/icons/layout.gif) | 12-9-22 .pdf | 2023-09-18 13:29 | 284K | |
![[ ]](/icons/layout.gif) | Harvesting_Knowledge_Big_Data_in_Agriculture_&_Food_Conference_Programme.pdf | 2023-09-18 13:29 | 293K | |
![[IMG]](/icons/image2.gif) | MainContent_news_FarmWalkandTalk2018.jpg | 2024-01-13 21:47 | 295K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_15th_May_2017.pdf | 2023-09-18 13:29 | 296K | |
![[IMG]](/icons/image2.gif) | one health4.jpeg | 2024-02-25 22:18 | 297K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_29nd_May_2017.pdf | 2023-09-18 13:29 | 303K | |
![[ ]](/icons/layout.gif) | 2024 Annual Report.pdf | 2025-03-06 11:15 | 304K | |
![[ ]](/icons/layout.gif) | 1. Achieving improvement in water quality through targeted organic manure sorage advice.pdf | 2024-01-13 21:47 | 304K | |
![[ ]](/icons/layout.gif) | 8. Advisory approaches for adoption of Selective Dry Cow Therapy.pdf | 2024-01-13 21:47 | 306K | |
![[IMG]](/icons/image2.gif) | Gr5gaXlWoAA95vo.jpeg | 2025-06-06 13:11 | 307K | |
![[ ]](/icons/layout.gif) | 10. Examining dairy farmers decision making process regarding core and non core tasks .pdf | 2024-01-13 21:47 | 308K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_23rd_April_2018.pdf | 2023-09-18 13:29 | 313K | |
![[ ]](/icons/layout.gif) | 9. An examination of KT from the Hen Harrier Project relevant to Teagasc KT programmes.pdf | 2024-01-13 21:47 | 316K | |
![[ ]](/icons/layout.gif) | Further details.pdf | 2024-01-13 21:47 | 316K | |
![[ ]](/icons/layout.gif) | 11. How will Irish dairy farmers adapt if permissible organic nitrogen stocking rate limits are reduced.pdf | 2024-01-13 21:47 | 325K | |
![[ ]](/icons/layout.gif) | Associate or Assistant Professor in Horticulture.pdf | 2025-05-27 12:19 | 325K | |
![[ ]](/icons/layout.gif) | 4. Evaluation of the Teagasc podcast as a virtual advisory method and recommendations for future development.pdf | 2024-01-13 21:47 | 326K | |
![[IMG]](/icons/image2.gif) | MainContent_WF2018.jpg | 2024-01-13 21:47 | 326K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialimage_AustinONeill.jpg | 2023-09-18 13:29 | 334K | |
![[ ]](/icons/layout.gif) | Outline.pdf | 2024-01-13 21:47 | 340K | |
![[ ]](/icons/layout.gif) | 7. The perception of horticulture as a career among school leavers.pdf | 2024-01-13 21:47 | 340K | |
![[IMG]](/icons/image2.gif) | headshaking horses.jpeg | 2024-02-19 00:17 | 343K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_9th_Oct_2017.pdf | 2023-09-18 13:29 | 344K | |
![[IMG]](/icons/image2.gif) | CO-Centre SFS_2024-05-29.jpeg | 2024-05-29 22:15 | 347K | |
![[ ]](/icons/unknown.gif) | 18092023.docx | 2023-10-19 14:18 | 347K | |
![[ ]](/icons/unknown.gif) | 25092023 .docx | 2023-10-19 14:18 | 347K | |
![[ ]](/icons/unknown.gif) | 110923.docx | 2023-09-26 15:47 | 347K | |
![[ ]](/icons/unknown.gif) | 16102023.docx | 2023-10-19 14:18 | 347K | |
![[ ]](/icons/unknown.gif) | 310723 .docx | 2023-09-18 13:29 | 348K | |
![[ ]](/icons/unknown.gif) | 240723.docx | 2023-09-18 13:29 | 348K | |
![[ ]](/icons/unknown.gif) | 040923.docx | 2023-09-18 13:29 | 348K | |
![[IMG]](/icons/image2.gif) | our rural future.jpeg | 2024-05-27 14:16 | 352K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_17th_Oct_2017.pdf | 2023-09-18 13:29 | 362K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_13th_Nov_2017.pdf | 2023-09-18 13:29 | 363K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_04th_Dec_2017.pdf | 2023-09-18 13:29 | 363K | |
![[IMG]](/icons/image2.gif) | Members of the UCD School of Agriculture and Food Science EDI Committee.jpg | 2023-09-18 13:29 | 364K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialimage_ShelbyWallace.jpg | 2023-09-18 13:29 | 368K | |
![[ ]](/icons/layout.gif) | UCD Lyons Systems Herd - 3 Year Report.pdf | 2023-09-18 13:29 | 372K | |
![[IMG]](/icons/image2.gif) | StudentTestimonialimage_BrittanyMeyer.jpg | 2023-09-18 13:29 | 374K | |
![[ ]](/icons/layout.gif) | UCD Systems Herd Annual Report for 2020 (web).pdf | 2023-09-18 13:29 | 383K | |
![[IMG]](/icons/image2.gif) | IMG-20241101-WA0004.jpg | 2024-11-09 21:44 | 390K | |
![[IMG]](/icons/image2.gif) | 1983 Class reunion - Guest speaker.jpg | 2024-01-13 21:47 | 398K | |
![[IMG]](/icons/image2.gif) | MainContent_IPSAM.jpg | 2024-01-13 21:47 | 401K | |
![[ ]](/icons/layout.gif) | UCD AgandFood Symposium-Achieving Our Agricultural Climate Targets- Pathways For Success Programme.pdf | 2023-09-18 13:29 | 402K | |
![[IMG]](/icons/image2.gif) | InsideBannermobile_About.jpg | 2023-09-18 13:29 | 403K | |
![[ ]](/icons/layout.gif) | Can I make my teaching more gender inclusive and why - Dr. Monica Gorman.pdf | 2023-09-18 13:29 | 414K | |
![[IMG]](/icons/image2.gif) | 49bf96ac-9203-4260-b28d-06db43d494f3.jpg | 2025-03-27 23:43 | 425K | |
![[IMG]](/icons/image2.gif) | IMG_5924.jpeg | 2024-05-31 10:46 | 427K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_09th_April_2018.pdf | 2023-09-18 13:29 | 447K | |
![[IMG]](/icons/image2.gif) | SAFS_SummerSchool_Web_Slider_Desktop-750x358.png | 2024-01-13 21:47 | 452K | |
![[IMG]](/icons/image2.gif) | Mental_Health_Survey-750x422.png | 2024-01-13 21:47 | 455K | |
![[ ]](/icons/layout.gif) | Lyons_Systems_Research_Herd_Notes_16th_April_2018.pdf | 2023-09-18 13:29 | 460K | |
![[IMG]](/icons/image2.gif) | FWT_Web_Slider_Homepage-750x358.png | 2024-01-13 21:47 | 463K | |
![[IMG]](/icons/image2.gif) | Teaching and Learning.png | 2023-09-18 13:29 | 465K | |
![[IMG]](/icons/image2.gif) | 1983 Class reunion - Organisers.jpg | 2024-01-13 21:47 | 470K | |
![[ ]](/icons/layout.gif) | Lecturer_Assistant_Professor_in_Forestry.pdf | 2024-01-13 21:47 | 487K | |
![[IMG]](/icons/image2.gif) | InsideBanner_Study.jpg | 2023-09-18 13:29 | 493K | |
![[ ]](/icons/layout.gif) | Walsh_Fellowship_Masters_(MAgrSc)_in_Agricultural_Innovation_Support.pdf | 2024-01-13 21:47 | 493K | |
![[IMG]](/icons/image2.gif) | Agri Aware Executive Director Marcus O'Halloran and Professor Frank Monahan, Dean of Agriculture and Head, UCD School of Agriculture and Food Science .jpg | 2023-09-18 13:29 | 501K | |
![[IMG]](/icons/image2.gif) | Main Content_Research_Forestry.jpg | 2024-01-13 21:47 | 514K | |
![[IMG]](/icons/image2.gif) | field 12.jpg | 2024-01-17 18:17 | 515K | |
![[ ]](/icons/layout.gif) | UCD Systems Herd Annual Report 2021 Final.pdf | 2023-09-18 13:29 | 520K | |
![[IMG]](/icons/image2.gif) | MainContent_AgSoc2018.jpg | 2024-01-13 21:47 | 521K | |
![[IMG]](/icons/image2.gif) | IMG_5583.jpg | 2025-06-09 13:42 | 546K | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-05-02 at 17.44.43.png | 2024-05-02 18:15 | 548K | |
![[ ]](/icons/layout.gif) | Walsh_Fellowship_Masters_(MAgrSc)_in_Agricultural_Extension_and_Innovation.pdf | 2024-01-13 21:47 | 552K | |
![[ ]](/icons/unknown.gif) | 02102023.docx | 2023-10-19 14:18 | 553K | |
![[IMG]](/icons/image2.gif) | IMG_3871 copy.jpg | 2025-06-06 15:41 | 558K | |
![[IMG]](/icons/image2.gif) | Award_Image.png | 2024-01-13 21:47 | 560K | |
![[ ]](/icons/layout.gif) | Professional Diploma in Food Safety and Regulatory Science.pdf | 2023-09-18 13:29 | 560K | |
![[IMG]](/icons/image2.gif) | IMG_3679 2 copy.jpeg | 2025-06-06 12:42 | 561K | |
![[ ]](/icons/layout.gif) | Farmers Monthty, March 2022. Interview with Prof. Frank Monahan..pdf | 2024-01-13 21:47 | 563K | |
![[IMG]](/icons/image2.gif) | Moya Ryan-1.jpg | 2025-05-11 18:11 | 578K | |
![[IMG]](/icons/image2.gif) | Moya Ryan.jpg | 2025-06-13 08:16 | 578K | |
![[ ]](/icons/layout.gif) | UCD Systems Herd Annual Report 2022 Final Published .pdf | 2023-09-18 13:29 | 580K | |
![[ ]](/icons/layout.gif) | McMahon et al_JOA.pdf | 2024-01-13 21:47 | 582K | |
![[ ]](/icons/layout.gif) | Research Assistant 48months.pdf | 2024-02-20 14:50 | 583K | |
![[ ]](/icons/layout.gif) | Mc_Carrick_Award_Applicant_Guidelines.pdf | 2024-01-13 21:47 | 591K | |
![[TXT]](/icons/text.gif) | main.min-1.css | 2025-03-19 09:43 | 602K | |
![[ ]](/icons/layout.gif) | Advances in Knowledge & Technologies for Agriculture Conference brochure.pdf | 2024-01-13 21:47 | 613K | |
![[IMG]](/icons/image2.gif) | AS_Award_Desktop-750-750x358.png | 2024-01-13 21:47 | 636K | |
![[ ]](/icons/layout.gif) | Post Doc Researcher SETU .pdf | 2024-02-20 14:50 | 647K | |
![[IMG]](/icons/image2.gif) | InsideBanner_GTProgrammes.jpg | 2023-09-18 13:29 | 647K | |
![[IMG]](/icons/image2.gif) | UCDNOVA_Lyons_650-750x422.png | 2024-01-13 21:47 | 649K | |
![[IMG]](/icons/image2.gif) | sheep1.jpeg | 2025-02-01 00:39 | 664K | |
![[IMG]](/icons/image2.gif) | English - UCD Summer School - Facebook Event Cover-693x390.png | 2024-05-02 15:46 | 700K | |
![[IMG]](/icons/image2.gif) | 106 E25A0815.JPG | 2024-02-29 20:47 | 703K | |
![[IMG]](/icons/image2.gif) | AgSoc_Cheque_Presentation_2021-650x414.png | 2024-01-13 21:47 | 705K | |
![[ ]](/icons/layout.gif) | Post Doc Researcher 48 Months.pdf | 2024-02-20 14:50 | 708K | |
![[IMG]](/icons/image2.gif) | GsLym7rXAAAi1YZ copy.jpeg | 2025-06-06 12:41 | 747K | |
![[IMG]](/icons/image2.gif) | nuffield zoe 2-691x382.png | 2024-10-08 20:14 | 764K | |
![[ ]](/icons/layout.gif) | UCD Rethinking the Food Systems, 9th December 2020 - Programme.pdf | 2023-09-18 13:29 | 775K | |
![[IMG]](/icons/image2.gif) | Web_Graduate_Research.png | 2023-09-18 13:29 | 784K | |
![[IMG]](/icons/image2.gif) | Web_Lyons_Farm_2.png | 2023-09-18 13:29 | 796K | |
![[IMG]](/icons/image2.gif) | Web_Exec_Education.png | 2023-09-18 13:29 | 811K | |
![[IMG]](/icons/image2.gif) | crillo.jpeg | 2024-04-05 20:15 | 820K | |
![[IMG]](/icons/image2.gif) | Web_News.png | 2024-01-13 21:47 | 820K | |
![[IMG]](/icons/image2.gif) | Web_Alumni-1.png | 2023-09-18 13:29 | 835K | |
![[IMG]](/icons/image2.gif) | Web_Alumni.png | 2023-09-18 13:29 | 835K | |
![[IMG]](/icons/image2.gif) | food science and health banner.png | 2025-02-24 11:39 | 841K | |
![[IMG]](/icons/image2.gif) | My Uni Life_Lyons Farm_UCD_Ep6 IMG4-4284x2856.jpg | 2024-02-12 14:19 | 868K | |
![[ ]](/icons/layout.gif) | LA&S booklet 2020.pdf | 2023-09-18 13:29 | 871K | |
![[IMG]](/icons/image2.gif) | Web_Contact_Us.png | 2023-09-18 13:29 | 871K | |
![[IMG]](/icons/image2.gif) | la-solid-900-1.svg | 2023-09-18 13:29 | 902K | |
![[IMG]](/icons/image2.gif) | new zealand4 copy.jpg | 2025-04-06 19:43 | 906K | |
![[IMG]](/icons/image2.gif) | la-brands-400-1.svg | 2023-09-18 13:29 | 906K | |
![[ ]](/icons/layout.gif) | MAgrSc_MAEI_Part_time_Distance_Learning.pdf | 2024-01-13 21:47 | 925K | |
![[IMG]](/icons/image2.gif) | SInead Flannery to be uploaded.jpg | 2025-05-26 23:11 | 954K | |
![[IMG]](/icons/image2.gif) | nuffield zoe 2.png | 2024-10-08 20:14 | 1.0M | |
![[IMG]](/icons/image2.gif) | UCD-AgandFood-Symposium-2022-Facebook-Post-1200x630px.png | 2023-09-18 13:29 | 1.0M | |
![[IMG]](/icons/image2.gif) | web news.JPG | 2025-02-15 22:09 | 1.0M | |
![[IMG]](/icons/image2.gif) | IMG_5534 copy.jpg | 2025-06-09 13:42 | 1.1M | |
![[IMG]](/icons/image2.gif) | trudee.jpg | 2024-12-11 13:12 | 1.2M | |
![[IMG]](/icons/image2.gif) | UCD AgandFood Teagasc Knowledge Transfer Conference 2022 Eventbrite Cover 2160x1080px.jpg | 2023-09-18 13:29 | 1.2M | |
![[IMG]](/icons/image2.gif) | InsideBanner_About.jpg | 2023-09-18 13:29 | 1.2M | |
![[IMG]](/icons/image2.gif) | DSC_9283 (1).JPG | 2023-09-18 13:29 | 1.2M | |
![[IMG]](/icons/image2.gif) | Image74.jpg | 2023-09-18 13:29 | 1.3M | |
![[ ]](/icons/layout.gif) | Universal Design for Learning, Dr Lisa Padden, University for All, UCD.pdf | 2023-09-18 13:29 | 1.3M | |
![[IMG]](/icons/image2.gif) | hort banner.png | 2025-03-10 23:42 | 1.3M | |
![[ ]](/icons/layout.gif) | Intercultural Learning - Dr Sheena Hyland, UCD Teaching and Learning.pdf | 2023-09-18 13:29 | 1.3M | |
![[IMG]](/icons/image2.gif) | IMG_5505.jpg | 2025-06-09 13:42 | 1.3M | |
![[IMG]](/icons/image2.gif) | kirstie2.png | 2025-01-31 23:39 | 1.4M | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-01-13 at 21.51.08.png | 2024-01-13 22:47 | 1.4M | |
![[ ]](/icons/layout.gif) | Neurodiversity - Dr Blánaid Gavin.pdf | 2023-09-18 13:29 | 1.4M | |
![[IMG]](/icons/image2.gif) | 262 E25A8248.JPG | 2023-12-09 20:46 | 1.4M | |
![[IMG]](/icons/image2.gif) | GsLym7rXAAAi1YZ.jpeg | 2025-06-06 12:10 | 1.5M | |
![[IMG]](/icons/image2.gif) | EoinLowryAlumni.jpg | 2023-10-06 11:46 | 1.5M | |
![[IMG]](/icons/image2.gif) | Frank_Monahan.jpg | 2023-09-18 13:29 | 1.5M | |
![[ ]](/icons/layout.gif) | Macra Agricultural Skillnet MAgrSc 2023.pdf | 2024-01-13 21:47 | 1.6M | |
![[IMG]](/icons/image2.gif) | 113 HQ4A3395.JPG | 2024-01-13 23:17 | 1.7M | |
![[IMG]](/icons/image2.gif) | IMG_2113 copy-1.jpg | 2025-03-30 17:58 | 1.8M | |
![[IMG]](/icons/image2.gif) | IMG_2113 copy.jpg | 2025-03-30 17:58 | 1.8M | |
![[IMG]](/icons/image2.gif) | 118 HQ4A6736.JPG | 2025-02-13 21:09 | 1.9M | |
![[IMG]](/icons/image2.gif) | UCD-AgandFood-Symposium-2024-Eventbrite-2160x1080px (1).png | 2024-11-07 11:44 | 1.9M | |
![[ ]](/icons/layout.gif) | 2018_Knowledge_Transfer_Conference_Programme.pdf | 2024-01-13 21:47 | 1.9M | |
![[IMG]](/icons/image2.gif) | SInead Flannery.jpg | 2025-05-19 18:11 | 2.1M | |
![[IMG]](/icons/image2.gif) | 20240626-teagasc-197.jpg | 2024-06-28 13:45 | 2.1M | |
![[IMG]](/icons/image2.gif) | IMG_2935.jpg | 2024-07-24 09:45 | 2.1M | |
![[IMG]](/icons/image2.gif) | IMG_5584.jpg | 2025-06-09 13:42 | 2.1M | |
![[IMG]](/icons/image2.gif) | Web_UpcomingEvents.png | 2023-09-18 13:29 | 2.2M | |
![[IMG]](/icons/image2.gif) | Women in Agriculture-5 copy.jpg | 2025-04-06 18:12 | 2.2M | |
![[IMG]](/icons/image2.gif) | 3068634.jpg | 2025-03-30 17:58 | 2.2M | |
![[IMG]](/icons/image2.gif) | Daire_Cregg.jpg | 2025-03-30 17:58 | 2.2M | |
![[IMG]](/icons/image2.gif) | IMG_3667.jpg | 2025-06-06 13:11 | 2.2M | |
![[IMG]](/icons/image2.gif) | IMG_5585.jpg | 2025-06-09 13:42 | 2.3M | |
![[IMG]](/icons/image2.gif) | careers day pic.jpeg | 2024-01-13 20:17 | 2.3M | |
![[IMG]](/icons/image2.gif) | new zealand4.jpg | 2025-04-06 19:43 | 2.4M | |
![[IMG]](/icons/image2.gif) | IMG_5537.jpg | 2025-06-09 13:42 | 2.4M | |
![[IMG]](/icons/image2.gif) | Equine Press Release Image 04.07.19 - Web Main.png | 2024-01-13 21:47 | 2.4M | |
![[IMG]](/icons/image2.gif) | UCD Lyons Farm 2 (1).jpg | 2025-05-06 21:42 | 2.4M | |
![[IMG]](/icons/image2.gif) | Class pic Patrick.JPG | 2025-02-14 13:09 | 2.4M | |
![[IMG]](/icons/image2.gif) | Daire, Frank and Karina.png | 2025-03-30 17:58 | 2.5M | |
![[IMG]](/icons/image2.gif) | web image.jpg | 2024-09-24 23:44 | 2.5M | |
![[IMG]](/icons/image2.gif) | 154 HQ4A9733.JPG | 2024-11-22 14:11 | 2.5M | |
![[IMG]](/icons/image2.gif) | MRN-Photography-Matthew-Rose-Nel-UCD-Careers-Stock-photos-4888.jpg | 2024-01-04 12:17 | 2.5M | |
![[IMG]](/icons/image2.gif) | Cari Headshot.jpg | 2024-10-03 13:15 | 2.5M | |
![[IMG]](/icons/image2.gif) | Lyons 4 - Faisal (1).JPG | 2024-01-14 01:18 | 2.5M | |
![[IMG]](/icons/image2.gif) | Women in Agriculture-5.jpg | 2025-03-27 21:42 | 2.6M | |
![[ ]](/icons/layout.gif) | Unconscious Bias Introduction - Dr. Fiona Darby, TU Dublin.pdf | 2023-09-18 13:29 | 2.6M | |
![[IMG]](/icons/image2.gif) | IMG_3875.jpg | 2025-06-06 22:41 | 2.6M | |
![[IMG]](/icons/image2.gif) | KP and AE.jpg | 2024-07-15 11:14 | 2.8M | |
![[IMG]](/icons/image2.gif) | English - UCD Summer School - Facebook Event Cover.png | 2024-05-02 18:15 | 2.9M | |
![[ ]](/icons/layout.gif) | UCD Teagasc Knowledge Transfer Conference 2021 - Programme.pdf | 2023-09-18 13:29 | 3.0M | |
![[ ]](/icons/layout.gif) | Driving_Farm_Innovation_through_Knowledge_Transfer_2015_Conference_Brochure.pdf | 2024-01-13 21:47 | 3.1M | |
![[IMG]](/icons/image2.gif) | Zoe hort copy.jpg | 2024-09-30 13:45 | 3.3M | |
![[ ]](/icons/layout.gif) | adn2094.pdf | 2025-02-01 16:39 | 3.4M | |
![[ ]](/icons/layout.gif) | Herd_Notes_19_June_2017.pdf | 2023-09-18 13:29 | 3.5M | |
![[IMG]](/icons/image2.gif) | IMG_3819.JPG | 2025-06-06 22:41 | 3.6M | |
![[IMG]](/icons/image2.gif) | walk and talk 1.png | 2024-03-19 14:48 | 3.7M | |
![[IMG]](/icons/image2.gif) | image00061.jpg | 2025-03-27 23:43 | 3.8M | |
![[IMG]](/icons/image2.gif) | 46 AG8I1808.jpg | 2024-04-02 11:46 | 3.8M | |
![[IMG]](/icons/image2.gif) | IMG_1296.jpg | 2025-06-06 12:41 | 4.0M | |
![[ ]](/icons/layout.gif) | SAFS Athena Swan Silver Application Redacted.pdf | 2024-01-13 21:47 | 4.0M | |
![[ ]](/icons/layout.gif) | UCD AgandFood Teagasc Knowledge Transfer Conference 2022 2pg A4 Programme 24.10.2022.pdf | 2023-09-18 13:29 | 4.0M | |
![[IMG]](/icons/image2.gif) | UG progs_AES.jpg | 2023-12-12 12:18 | 4.2M | |
![[IMG]](/icons/image2.gif) | IMG_2305.jpg | 2025-03-27 23:43 | 4.3M | |
![[IMG]](/icons/image2.gif) | eyeon.ie-404995.jpg | 2025-02-26 22:39 | 4.4M | |
![[IMG]](/icons/image2.gif) | Paul Slade1_Curlew.jpg | 2024-06-28 16:44 | 4.4M | |
![[IMG]](/icons/image2.gif) | IMG_0290.jpg | 2024-11-19 14:14 | 4.5M | |
![[IMG]](/icons/image2.gif) | grad1.jpg | 2024-06-28 16:14 | 4.6M | |
![[IMG]](/icons/image2.gif) | IMG_3664 2.jpeg | 2025-06-06 13:11 | 4.7M | |
![[IMG]](/icons/image2.gif) | LLDL5925.jpeg | 2024-07-10 13:15 | 4.7M | |
![[IMG]](/icons/image2.gif) | IMG_3907.jpg | 2025-06-06 22:41 | 4.8M | |
![[ ]](/icons/layout.gif) | Macra Skillnet MAgrSc-1.pdf | 2025-05-26 01:42 | 4.8M | |
![[IMG]](/icons/image2.gif) | 1712134634584.jpeg | 2024-04-05 19:45 | 4.8M | |
![[ ]](/icons/layout.gif) | Macra Skillnet MAgrSc 2022.pdf | 2024-01-13 21:47 | 4.9M | |
![[IMG]](/icons/image2.gif) | Horticulturerosemount2.jpg | 2025-05-27 12:19 | 4.9M | |
![[ ]](/icons/layout.gif) | Developing_Our_Farm_Advisory _and_Education_Services_Conference_Brochure.pdf | 2024-01-13 21:47 | 5.0M | |
![[IMG]](/icons/image2.gif) | IMG_2118.jpg | 2025-03-10 13:11 | 5.0M | |
![[ ]](/icons/layout.gif) | UCD AgandFood Symposium 2024 Full Programme copy.pdf | 2024-12-01 16:42 | 5.1M | |
![[ ]](/icons/layout.gif) | Walsh Scholarship Programmes 2pg A4 080323 (1).pdf | 2024-01-13 21:47 | 5.1M | |
![[IMG]](/icons/image2.gif) | IMG_3785.jpg | 2025-06-06 22:41 | 5.2M | |
![[ ]](/icons/layout.gif) | UCD Careers Graduate Handbook 2025 WEB (1).pdf | 2025-02-17 11:09 | 5.3M | |
![[ ]](/icons/layout.gif) | Macra Skillnet MAgrSc.pdf | 2025-05-26 01:42 | 5.4M | |
![[IMG]](/icons/image2.gif) | IMG_3804.JPG | 2025-06-06 22:41 | 5.6M | |
![[IMG]](/icons/image2.gif) | IMG_3675 2.jpeg | 2025-06-06 13:11 | 5.7M | |
![[ ]](/icons/layout.gif) | UCD Careers 2021 (handbookfinal_web).pdf | 2023-09-18 13:29 | 6.0M | |
![[IMG]](/icons/image2.gif) | IMG_3779 3.jpg | 2025-06-06 15:41 | 6.1M | |
![[IMG]](/icons/image2.gif) | IMG_2820.jpg | 2025-04-24 18:42 | 6.6M | |
![[ ]](/icons/layout.gif) | UCD Careers 2024 WEB.pdf | 2024-03-01 20:18 | 6.8M | |
![[ ]](/icons/layout.gif) | UCD Careers 2022_WEB_FINAL.pdf | 2023-09-18 13:29 | 7.4M | |
![[IMG]](/icons/image2.gif) | MSC_0101.JPG | 2024-02-12 14:49 | 7.5M | |
![[IMG]](/icons/image2.gif) | image00031.jpg | 2025-06-15 05:10 | 7.5M | |
![[IMG]](/icons/image2.gif) | image00031-1.jpg | 2025-03-27 23:43 | 8.4M | |
![[IMG]](/icons/image2.gif) | image00035.jpg | 2025-03-27 23:43 | 8.9M | |
![[ ]](/icons/layout.gif) | Driving_Farm_Innovation_through_Knowledge_Transfer_conference_2015_Presentations.pdf | 2024-01-13 21:47 | 9.6M | |
![[IMG]](/icons/image2.gif) | My Uni Life_Lyons Farm_UCD_Ep6 IMG2.jpg | 2024-02-12 15:18 | 10M | |
![[IMG]](/icons/image2.gif) | image00140.jpg | 2025-03-27 23:12 | 11M | |
![[ ]](/icons/layout.gif) | UCD Careers 2023 - no contact.pdf | 2023-09-18 13:29 | 12M | |
![[ ]](/icons/layout.gif) | UCD_Dairy_Research_and_Education_Facility_infographic_2016.pdf | 2024-01-13 21:47 | 14M | |
![[ ]](/icons/layout.gif) | Driving_Farm_Innovation_through_Knowledge_Transfer_conference_2015_Posters.pdf | 2024-01-13 21:47 | 16M | |
![[IMG]](/icons/image2.gif) | My Uni Life_Lyons Farm_UCD_Ep6 IMG3.jpg | 2024-02-12 14:49 | 26M | |
|