![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | UCD_Panorama_L.jpg | 2024-03-08 12:52 | 13M | |
![[IMG]](/icons/image2.gif) | 20250221_105641 (1) Michelle Photos .jpg | 2025-03-24 15:44 | 2.9M | |
![[IMG]](/icons/image2.gif) | Screenshot 2024-02-09 at 11.52.31.png | 2024-03-08 12:52 | 2.8M | |
![[ ]](/icons/layout.gif) | 2025_26_Start_of_term_presentation.pdf | 2025-07-23 20:08 | 2.7M | |
![[IMG]](/icons/image2.gif) | gb.png | 2025-05-23 13:43 | 2.0M | |
![[ ]](/icons/layout.gif) | How-to-guide_Manual-Registration_Banner_Dec_23.pdf | 2024-03-08 12:52 | 2.0M | |
![[ ]](/icons/layout.gif) | Updated - School Grading Summary.pptx.pdf | 2024-12-13 14:43 | 1.8M | |
![[ ]](/icons/layout.gif) | Updated - My Module Grades - Guide.pptx.pdf | 2024-12-13 14:43 | 1.7M | |
![[ ]](/icons/layout.gif) | Updated - Programme Exam Board Reporting.pptx.pdf | 2024-12-13 14:43 | 1.6M | |
![[ ]](/icons/layout.gif) | Updated - My Module Grades - Reports.pptx.pdf | 2024-12-13 14:43 | 1.5M | |
![[IMG]](/icons/image2.gif) | feedback.png | 2025-05-23 13:43 | 1.5M | |
![[ ]](/icons/layout.gif) | 250924_Guidelines_for_UCD_Staff_How_Heads_of_Schools_respond_to_Extern_Examiner_for_Taught_Programmes_reports.pdf | 2024-09-25 20:14 | 1.4M | |
![[ ]](/icons/layout.gif) | Editing Module Descriptors guide 202526.pdf | 2025-06-20 16:42 | 1.3M | |
![[ ]](/icons/layout.gif) | 021024_Updated Guidelines for UCD Staff How Heads of Schools respond to Subject Extern Examiner reports.pdf | 2024-10-02 15:16 | 1.3M | |
![[ ]](/icons/unknown.gif) | GPPF Template_Dec 2024.docx | 2024-12-19 12:44 | 1.3M | |
![[ ]](/icons/layout.gif) | How to_ Define your Teaching Arrangements method for the Spring Trimester.pdf | 2024-03-08 12:52 | 1.2M | |
![[ ]](/icons/layout.gif) | Updated - Programme Audit Reports.pptx.pdf | 2024-12-13 14:43 | 1.1M | |
![[ ]](/icons/layout.gif) | Updated - Manual Grade Entry Guide.pptx.pdf | 2024-12-13 14:43 | 1.1M | |
![[ ]](/icons/layout.gif) | Editing Majors 202526 .pdf | 2025-02-10 11:09 | 1.1M | |
![[IMG]](/icons/image2.gif) | advisory.png | 2025-05-23 13:43 | 1.0M | |
![[ ]](/icons/layout.gif) | Exemptions_User_Guide.pdf | 2025-01-13 16:12 | 1.0M | |
![[ ]](/icons/layout.gif) | Editing Module Descriptors - 202425-1.pdf | 2025-02-24 10:39 | 1.0M | |
![[ ]](/icons/layout.gif) | RPL_Learner_Guide_FINAL19.02.pdf | 2025-05-07 14:14 | 968K | |
![[ ]](/icons/layout.gif) | Updated - Grade Transfer Guide.pptx.pdf | 2024-12-13 14:43 | 956K | |
![[IMG]](/icons/image2.gif) | la-brands-400.svg | 2025-07-02 03:10 | 906K | |
![[IMG]](/icons/image2.gif) | la-solid-900.svg | 2025-07-02 03:10 | 902K | |
![[IMG]](/icons/image2.gif) | 1712_Conferring_020a.jpg | 2025-05-07 10:44 | 860K | |
![[ ]](/icons/layout.gif) | Submitting a Timesheet with Unijobs.pdf | 2025-08-15 10:40 | 859K | |
![[ ]](/icons/layout.gif) | 250924_How_to_Nominate_Extern_Examiners_for_Taught_Programmes.pdf | 2024-09-25 19:14 | 828K | |
![[IMG]](/icons/image2.gif) | 2505_CommunityUCD_036b.jpg | 2025-06-03 17:43 | 806K | |
![[IMG]](/icons/image2.gif) | Kaylin Bednarz.jpg | 2024-09-27 09:15 | 789K | |
![[ ]](/icons/layout.gif) | Uploading_Grades_Guide.pdf | 2025-04-01 11:44 | 782K | |
![[ ]](/icons/layout.gif) | Answer sheet type 2 A-Z (up to 50Q) Code S3234.pdf | 2024-03-08 12:52 | 781K | |
![[ ]](/icons/layout.gif) | Guide For UCD Staff How to assign Extern Examiners for Taught Programmes to UCD modules.pdf | 2025-07-08 11:40 | 771K | |
![[IMG]](/icons/image2.gif) | cherry.JPG | 2024-03-08 12:52 | 766K | |
![[ ]](/icons/layout.gif) | Module List Management guide 202526 .pdf | 2025-02-10 11:40 | 715K | |
![[ ]](/icons/layout.gif) | How_to_find_CRN_and_timetabling_info_2022.pdf | 2024-03-08 12:52 | 673K | |
![[ ]](/icons/layout.gif) | Summer Trimester Exam Question Papers Submission.pdf | 2025-06-26 11:57 | 628K | |
![[ ]](/icons/layout.gif) | Guide for UCD Staff How to nominate Special Extern Examiners (1).pdf | 2024-03-08 12:52 | 619K | |
![[ ]](/icons/layout.gif) | Updated - Stage Reassignment Guide.pptx.pdf | 2024-12-13 14:43 | 607K | |
![[TXT]](/icons/text.gif) | main.min.css | 2025-07-02 03:10 | 602K | |
![[ ]](/icons/layout.gif) | eProctoring Project Report to UMT EG.pdf | 2025-01-16 11:12 | 600K | |
![[ ]](/icons/layout.gif) | New Module Requests 202526 .pdf | 2025-02-10 12:39 | 570K | |
![[IMG]](/icons/image2.gif) | 0709_Health_Sci_003a_crop.jpg | 2025-05-07 10:44 | 550K | |
![[ ]](/icons/layout.gif) | Brightspace Quick Guide Extern Examiner Access-.pdf | 2024-03-08 12:52 | 526K | |
![[ ]](/icons/layout.gif) | Update_a_stage_for_a_module_via_InfoHub_2023.pdf | 2024-03-08 12:52 | 516K | |
![[ ]](/icons/layout.gif) | Summer Trimester, Draft Exam Timetable.pdf | 2025-07-02 13:09 | 512K | |
![[ ]](/icons/layout.gif) | Guide For Extern Examiners for Taught Programmes How to get access to UCD systems.pdf | 2025-07-08 10:40 | 506K | |
![[ ]](/icons/layout.gif) | Module_Access_Management_guide.pdf | 2025-01-14 14:43 | 484K | |
![[IMG]](/icons/image2.gif) | 1503_ChasInst_Labs_0346a-crop.jpg | 2025-05-07 10:44 | 478K | |
![[IMG]](/icons/image2.gif) | Prof Colin Scott pic - Copy head shot.JPG | 2025-06-03 13:12 | 467K | |
![[ ]](/icons/layout.gif) | Guidelines for Extern Examiners for Taught Programmes.pdf | 2025-06-03 17:43 | 445K | |
![[IMG]](/icons/image2.gif) | image_lake2023.jpg | 2025-01-29 13:12 | 445K | |
![[ ]](/icons/layout.gif) | UPB Local Approvals Flowchart June 2025.pdf | 2025-06-11 14:11 | 438K | |
![[IMG]](/icons/image2.gif) | rmtstructure25.png | 2025-08-21 12:09 | 436K | |
![[ ]](/icons/layout.gif) | Drop_Add_modules_general.pdf | 2024-10-02 15:16 | 419K | |
![[ ]](/icons/unknown.gif) | Excel sheet for manually calculating sub-components.xlsx | 2025-01-08 12:44 | 411K | |
![[IMG]](/icons/image2.gif) | 2111_Autumn_024a.jpg | 2024-03-08 12:52 | 411K | |
![[ ]](/icons/layout.gif) | Drop_Add_email_doc_Aut_23.pdf | 2024-03-08 12:52 | 408K | |
![[ ]](/icons/layout.gif) | Due Diligence and Risk Management_2024.pdf | 2024-12-12 12:13 | 391K | |
![[ ]](/icons/layout.gif) | How to Apply to UCD.pdf | 2024-10-01 16:46 | 380K | |
![[ ]](/icons/layout.gif) | LC_Summary_ER_2025.pdf | 2024-09-24 17:45 | 374K | |
![[ ]](/icons/layout.gif) | Update for SchoolsSMECs Autumn 202425 Grade Approvals Process.pdf | 2025-06-09 14:12 | 362K | |
![[ ]](/icons/layout.gif) | MCQ Answer Sheet Marking Instructions and Error Types Guide.pdf | 2024-03-08 12:52 | 350K | |
![[ ]](/icons/layout.gif) | SPACMNT screen Banner 9.pdf | 2024-03-08 12:52 | 336K | |
![[ ]](/icons/layout.gif) | Drop_Add_Modules_Spr_23-34.pdf | 2024-03-08 12:52 | 330K | |
![[ ]](/icons/layout.gif) | How_to_run_degree_compliance_in_InfoHub.pdf | 2024-03-08 12:52 | 326K | |
![[ ]](/icons/layout.gif) | Reminder Grading Support PEB reporting demo.pdf | 2025-06-09 13:43 | 324K | |
![[ ]](/icons/layout.gif) | Alternative Non-Linear Conversion Grade Scale 50 per cent Pass.pdf | 2025-04-08 10:44 | 320K | |
![[ ]](/icons/layout.gif) | _Autumn Trimester Exams, Final Arrangements Staff .pdf | 2024-12-02 13:42 | 319K | |
![[ ]](/icons/layout.gif) | Transcripts-Diploma-Supplements-Parchments-Conferring_revised_2024.pdf | 2024-11-29 12:12 | 304K | |
![[ ]](/icons/layout.gif) | Email to Staff - Assessment Email Contacts.pdf | 2025-01-14 16:13 | 293K | |
![[ ]](/icons/layout.gif) | How_to_use_TSICSRV.pdf | 2025-02-20 15:09 | 290K | |
![[ ]](/icons/layout.gif) | How_to_use_SFASTCA_in_Banner.pdf | 2025-02-13 13:10 | 289K | |
![[ ]](/icons/layout.gif) | Registering for a Unijobs Account.pdf | 2025-08-15 10:09 | 288K | |
![[ ]](/icons/layout.gif) | Annual Monitoring and Periodic Review_2024.pdf | 2024-12-12 12:13 | 287K | |
![[ ]](/icons/layout.gif) | Applicant_Privacy_Statement.pdf | 2024-03-08 12:52 | 286K | |
![[ ]](/icons/layout.gif) | Appeals_form.pdf | 2024-03-08 12:52 | 284K | |
![[ ]](/icons/layout.gif) | SSASECT screen Banner .pdf | 2024-03-08 12:52 | 275K | |
![[ ]](/icons/layout.gif) | Programme_Verification_Jira.pdf | 2025-07-01 12:47 | 267K | |
![[ ]](/icons/layout.gif) | Alternative Linear Conversion Grade Scale 60 per cent China only.pdf | 2025-04-08 10:44 | 265K | |
![[ ]](/icons/layout.gif) | Formal Agreements_2024.pdf | 2025-01-23 21:12 | 264K | |
![[ ]](/icons/layout.gif) | Spring Trimester Final Exam Arrangements 2025 Staff Email 300425.pdf | 2025-05-13 12:42 | 262K | |
![[ ]](/icons/layout.gif) | Collab Award Types, Taxonomies and Est Routes for Collab_Nov 2024.pdf | 2024-12-12 11:43 | 256K | |
![[ ]](/icons/layout.gif) | Grading Support training and GAP related demos - Spring 202425.pdf | 2025-06-09 14:12 | 256K | |
![[ ]](/icons/layout.gif) | Reminder School Grading Summary demonstrations.pdf | 2025-06-09 14:12 | 254K | |
![[ ]](/icons/layout.gif) | Correction; Summer Trimester, Draft Exam Timetable.pdf | 2025-07-02 13:09 | 254K | |
![[IMG]](/icons/image2.gif) | Joyce.JPG | 2024-03-08 12:52 | 253K | |
![[ ]](/icons/layout.gif) | UCD Directions Map to Simmonscourt - Updated Bus Route.pdf | 2025-04-24 13:13 | 250K | |
![[ ]](/icons/layout.gif) | Update_language_preference_in_browser.pdf | 2025-02-13 12:39 | 250K | |
![[ ]](/icons/layout.gif) | Invitation School Grading Summary demonstrations.pdf | 2025-06-09 14:12 | 242K | |
![[IMG]](/icons/image2.gif) | Tierney.jpg | 2024-03-08 12:52 | 240K | |
![[IMG]](/icons/image2.gif) | grid-overlay-footer.png | 2024-03-08 12:52 | 240K | |
![[IMG]](/icons/image2.gif) | 0810_TheatreL_010.jpg | 2025-06-03 11:43 | 240K | |
![[ ]](/icons/layout.gif) | How_to_use_SGAADVR_in_Banner.pdf | 2025-02-13 12:39 | 239K | |
![[ ]](/icons/layout.gif) | Spring trimester 20242025 Grade Approvals Process.pdf | 2025-06-09 13:43 | 238K | |
![[ ]](/icons/layout.gif) | Additional Considerations staff comm 1 (June 2025).pdf | 2025-06-17 15:12 | 237K | |
![[IMG]](/icons/image2.gif) | Tunnel_L.JPG | 2024-03-08 12:52 | 235K | |
![[IMG]](/icons/image2.gif) | University Awards table-557x740.PNG | 2024-12-13 14:43 | 234K | |
![[ ]](/icons/layout.gif) | University College Dublin Mail - Ukraine Student Fees and Financial Support Update (August 2024).pdf | 2024-08-21 15:15 | 225K | |
![[ ]](/icons/unknown.gif) | MCQ examination set-up form with guidelines.doc | 2024-03-08 12:52 | 224K | |
![[ ]](/icons/unknown.gif) | la-solid-900.eot | 2025-07-02 03:10 | 221K | |
![[ ]](/icons/unknown.gif) | MCQ examination set-up form with guidelines 120922.doc | 2024-03-08 12:52 | 221K | |
![[ ]](/icons/unknown.gif) | la-solid-900.ttf | 2025-07-02 03:10 | 221K | |
![[ ]](/icons/layout.gif) | How_to_use_SOAIDEN_in_Banner.pdf | 2025-02-13 14:09 | 214K | |
![[ ]](/icons/layout.gif) | UCD Directions Map to Shelbourne Hall - Updated Bus Route.pdf | 2025-04-24 13:13 | 207K | |
![[IMG]](/icons/image2.gif) | hero-1.png | 2024-03-08 12:52 | 206K | |
![[ ]](/icons/layout.gif) | UCDlearner_guide_flyer_mar25.pdf | 2025-08-12 10:09 | 206K | |
![[ ]](/icons/layout.gif) | UCD guide for learners Flyer feb 25.pdf | 2025-05-07 14:14 | 206K | |
![[IMG]](/icons/image2.gif) | 0401_laptop_014.jpg | 2025-06-03 11:43 | 203K | |
![[ ]](/icons/layout.gif) | Update for PEBs Governing Boards Autumn 202425 Grade Approvals Process.pdf | 2025-06-09 14:12 | 202K | |
![[IMG]](/icons/image2.gif) | 45214134.jpg | 2025-05-07 14:14 | 199K | |
![[IMG]](/icons/image2.gif) | Remediation Infographic.png | 2024-12-13 14:43 | 196K | |
![[ ]](/icons/layout.gif) | Spring Trimester, Resit Exam Registration.pdf | 2025-02-13 12:39 | 195K | |
![[ ]](/icons/unknown.gif) | Intern Examiner Nomination form 2020-1.doc | 2025-05-28 04:50 | 194K | |
![[IMG]](/icons/image2.gif) | registry_cur.jpg | 2025-03-06 12:42 | 194K | |
![[ ]](/icons/layout.gif) | Additional Considerations for Assessment Policy Oct 2024.pdf | 2025-06-03 11:43 | 194K | |
![[IMG]](/icons/image2.gif) | grid-darken.svg | 2024-03-08 12:52 | 194K | |
![[ ]](/icons/layout.gif) | Reminder Summer trimester 2024_2025 Undergraduate Grade Approvals Process.pdf | 2025-08-08 14:40 | 193K | |
![[ ]](/icons/unknown.gif) | Intern Examiner Nomination form 2020.doc | 2025-07-01 08:19 | 193K | |
![[ ]](/icons/layout.gif) | FAO Module Coordinator Grade Entry and Sign Off deadline January 2025.pdf | 2025-06-09 14:12 | 188K | |
![[IMG]](/icons/image2.gif) | Hannon_L.JPG | 2024-03-08 12:52 | 187K | |
![[ ]](/icons/layout.gif) | Academic Calendars 25- 31.pdf | 2024-04-23 12:47 | 186K | |
![[ ]](/icons/layout.gif) | Financial-Arrangements-incFees_revised_2024.pdf | 2024-11-29 12:12 | 184K | |
![[ ]](/icons/layout.gif) | Update for PEBs Governing Boards Spring 202425 Grade Approvals Process.pdf | 2025-06-16 09:48 | 184K | |
![[IMG]](/icons/image2.gif) | pattern-white.svg | 2024-03-08 12:52 | 178K | |
![[ ]](/icons/layout.gif) | Award-Classification_revised_2024.pdf | 2024-11-29 12:12 | 176K | |
![[ ]](/icons/layout.gif) | Module Access Management Checklist-1.pdf | 2024-05-08 11:47 | 176K | |
![[ ]](/icons/layout.gif) | HEA_Data_Collection_notice_2025_26.pdf | 2025-07-15 21:09 | 174K | |
![[ ]](/icons/layout.gif) | External Reporting_2024.pdf | 2024-12-12 12:13 | 171K | |
![[ ]](/icons/layout.gif) | Edits to January-intake Majors Closing.pdf | 2024-04-23 09:16 | 171K | |
![[ ]](/icons/layout.gif) | Final Grade Entry Reminder Spring trimester 202425 (2).pdf | 2025-06-09 12:42 | 170K | |
![[ ]](/icons/layout.gif) | Student-Registration-and-Services_revised_2024.pdf | 2024-11-29 12:12 | 170K | |
![[IMG]](/icons/image2.gif) | study.jpg | 2025-07-02 03:10 | 169K | |
![[ ]](/icons/layout.gif) | Major Structure Review Checklist.pdf | 2025-05-13 11:44 | 169K | |
![[ ]](/icons/layout.gif) | Answer sheet type 4 True False Don't Know (up to 60Q) Code S3232.pdf | 2024-03-08 12:52 | 169K | |
![[IMG]](/icons/image2.gif) | Approval of Final Revised Thesis.png | 2025-03-24 15:44 | 168K | |
![[IMG]](/icons/image2.gif) | Theses Pic the thesis centre.png | 2025-03-24 15:44 | 168K | |
![[IMG]](/icons/image2.gif) | Image of Hardbound Thesis.png | 2025-03-24 15:44 | 168K | |
![[ ]](/icons/layout.gif) | Edits to January-intake Majors Open.pdf | 2024-04-23 09:16 | 167K | |
![[ ]](/icons/layout.gif) | Programme-Structures_revised_2024.pdf | 2024-11-29 12:12 | 165K | |
![[ ]](/icons/layout.gif) | Module Exemption Checklist .pdf | 2025-02-07 16:39 | 165K | |
![[ ]](/icons/layout.gif) | Answer sheet type 1 ABCDE (up to 120Q) Code S3231.pdf | 2024-03-08 12:52 | 165K | |
![[ ]](/icons/layout.gif) | Assessment-for-modules_revised_2024.pdf | 2024-11-29 12:12 | 165K | |
![[ ]](/icons/layout.gif) | Editing Major Structures Checklist.pdf | 2025-02-07 16:39 | 163K | |
![[ ]](/icons/layout.gif) | Autumn Trimester, Examinations Draft Timetable.pdf | 2024-03-08 12:52 | 162K | |
![[ ]](/icons/layout.gif) | SSASECQ screen Banner 9.pdf | 2024-03-08 12:52 | 161K | |
![[ ]](/icons/layout.gif) | Programme_Verification_Guidelines.pdf | 2025-07-01 12:47 | 159K | |
![[ ]](/icons/layout.gif) | Week_Ranges_2025_2026.pdf | 2025-07-15 16:09 | 158K | |
![[ ]](/icons/layout.gif) | CAO Selection.pdf | 2025-04-23 10:44 | 157K | |
![[ ]](/icons/layout.gif) | Exams Manager Issue - Notification Emails are not being sent.pdf | 2024-03-08 12:52 | 156K | |
![[IMG]](/icons/image2.gif) | rpl1.jpg | 2025-05-07 14:14 | 153K | |
![[ ]](/icons/unknown.gif) | la-brands-400.eot | 2025-07-02 03:10 | 153K | |
![[ ]](/icons/unknown.gif) | la-brands-400.ttf | 2025-07-02 03:10 | 152K | |
![[ ]](/icons/layout.gif) | How_to_log_into_Banner_Jan_24.pdf | 2025-02-13 13:10 | 152K | |
![[ ]](/icons/layout.gif) | Resit Exam Registration Autumn 23-24.pdf | 2024-03-08 12:52 | 152K | |
![[ ]](/icons/layout.gif) | Briefing Document - Additional Consideration for Assessment Academic Council October 2024.pdf | 2025-06-03 11:43 | 152K | |
![[ ]](/icons/layout.gif) | Checking_student_information_UView_InfoHub.pdf | 2024-03-08 12:52 | 149K | |
![[ ]](/icons/layout.gif) | Answer sheet type 3 True False Unanswered (up to 20Q) Code S3233.pdf | 2024-03-08 12:52 | 148K | |
![[ ]](/icons/layout.gif) | Module Descriptor Edit Timelines 2024-25-1.pdf | 2024-11-19 13:44 | 148K | |
![[ ]](/icons/layout.gif) | Clear_browser_data_Chrome.pdf | 2025-02-20 13:39 | 146K | |
![[ ]](/icons/layout.gif) | University College Dublin Mail - Exams Manager Issue - Now Resolved.pdf | 2024-03-08 12:52 | 146K | |
![[ ]](/icons/layout.gif) | Module Descriptor edit timelines 202526.pdf | 2025-06-27 14:47 | 146K | |
![[ ]](/icons/layout.gif) | Spring Trimester, Draft Exam Timetable.pdf | 2025-02-25 10:39 | 146K | |
![[ ]](/icons/layout.gif) | Grad Entry Vet Med Guidelines.pdf | 2024-03-14 12:50 | 145K | |
![[ ]](/icons/layout.gif) | Major & Programme MLM Edit Timelines 202425 C&S.pdf | 2024-10-10 11:15 | 145K | |
![[ ]](/icons/layout.gif) | Module Descriptor Checklist .pdf | 2025-02-07 16:39 | 143K | |
![[TXT]](/icons/text.gif) | swiper-bundle.min.js | 2024-03-08 12:52 | 143K | |
![[ ]](/icons/layout.gif) | Summer trimester 2024 2025 Undergraduate Grade Approvals Process.pdf | 2025-07-28 15:10 | 142K | |
![[ ]](/icons/layout.gif) | Invitation Grade Entry demonstrations.pdf | 2025-06-09 14:12 | 137K | |
![[ ]](/icons/layout.gif) | ACCEMeetingDates.pdf | 2025-07-03 12:09 | 137K | |
![[IMG]](/icons/image2.gif) | business_analyst.jpg | 2024-03-08 12:52 | 134K | |
![[ ]](/icons/layout.gif) | UCD_IT_Access_Jan_24.pdf | 2025-04-02 09:43 | 132K | |
![[ ]](/icons/layout.gif) | Missing or Incorrect Stage Assignments.pdf | 2025-06-09 14:12 | 132K | |
![[ ]](/icons/layout.gif) | Assessment Email Contacts.pdf | 2025-01-13 11:12 | 131K | |
![[ ]](/icons/layout.gif) | Updated Grading Support webpages.pdf | 2025-06-09 14:12 | 130K | |
![[ ]](/icons/layout.gif) | Joint Degree Report Guidelines.pdf | 2025-07-02 03:10 | 130K | |
![[ ]](/icons/layout.gif) | Exam Portal Open 1 Oct 24.pdf | 2024-10-01 10:45 | 129K | |
![[ ]](/icons/layout.gif) | Exceptional Grade Change Deadline with a view to September Graduations.pdf | 2025-06-09 13:43 | 129K | |
![[ ]](/icons/layout.gif) | 030625 Instructions for Setting Up Your UCD Connect Account as an Extern Examiner.pdf | 2025-06-03 10:12 | 128K | |
![[ ]](/icons/layout.gif) | Banner_frequently_used_shortcuts.pdf | 2025-02-13 13:10 | 127K | |
![[ ]](/icons/layout.gif) | Summer Exam Session Key Dates 21 Jan.pdf | 2025-01-21 12:43 | 126K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Regular.woff | 2024-03-08 12:52 | 126K | |
![[ ]](/icons/layout.gif) | Autumn Trimester, Draft Exam Timetable Staff Email.pdf | 2024-10-25 12:17 | 126K | |
![[ ]](/icons/layout.gif) | Admissions_revised_2024.pdf | 2024-11-29 12:12 | 126K | |
![[ ]](/icons/layout.gif) | MLM edits 202526.pdf | 2025-06-27 14:47 | 125K | |
![[ ]](/icons/layout.gif) | Checking student information_UView_InfoHub.pdf | 2024-03-08 12:52 | 125K | |
![[ ]](/icons/layout.gif) | Curriculum Management Reports Checklist 202526.pdf | 2025-02-10 15:39 | 123K | |
![[ ]](/icons/layout.gif) | PDARF FLOW CHART.pdf | 2024-11-27 16:12 | 123K | |
![[ ]](/icons/unknown.gif) | la-solid-900.woff | 2025-07-02 03:10 | 122K | |
![[ ]](/icons/layout.gif) | Application Appeals form.pdf | 2024-04-30 12:17 | 122K | |
![[ ]](/icons/layout.gif) | CMS Opening.pdf | 2024-04-23 09:16 | 121K | |
![[ ]](/icons/layout.gif) | Privacy Policy for Extern Examiners draft 4.pdf | 2024-03-08 12:52 | 120K | |
![[ ]](/icons/layout.gif) | Resit Exam Registration Email.pdf | 2024-10-25 12:17 | 119K | |
![[IMG]](/icons/image2.gif) | Registry staff group photo_15May24-1016x718.jpg | 2024-07-02 11:15 | 119K | |
![[ ]](/icons/layout.gif) | Required_Information_for_Special_Extern_Examiner_Nomination.pdf | 2024-03-14 13:49 | 118K | |
![[ ]](/icons/layout.gif) | Major edit Timelines 202526.pdf | 2025-05-19 09:12 | 117K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Medium.woff | 2024-03-08 12:52 | 116K | |
![[IMG]](/icons/image2.gif) | moduleteachingarrangement.png | 2024-03-08 12:52 | 115K | |
![[IMG]](/icons/image2.gif) | Module Remediation Timing-888x659.png | 2024-12-13 14:43 | 115K | |
![[ ]](/icons/layout.gif) | 19_05_25_FinalChanges_September-intakeMajors.pdf | 2025-05-20 15:44 | 114K | |
![[ ]](/icons/layout.gif) | 23-08-24 IMPL Assessment Strategy Changes.pdf | 2024-08-26 10:45 | 114K | |
![[ ]](/icons/layout.gif) | Alert Sep 2024.pdf | 2024-10-03 09:16 | 114K | |
![[ ]](/icons/unknown.gif) | PDARF2 New Programme Proposal (UMT)_Final June 2019.docx | 2024-03-08 12:52 | 114K | |
![[ ]](/icons/layout.gif) | 12-12-25 CMS Open for Edits.pdf | 2025-02-12 23:42 | 113K | |
![[ ]](/icons/layout.gif) | CMS Edits to Module Trimester and Status, and Careers & Skills Statements Closing 27 June.pdf | 2025-06-24 18:20 | 112K | |
![[IMG]](/icons/image2.gif) | structure2.jpg | 2025-05-27 10:20 | 111K | |
![[IMG]](/icons/image2.gif) | la-regular-400.svg | 2025-07-02 03:10 | 111K | |
![[IMG]](/icons/image2.gif) | University Awards table.PNG | 2024-12-13 14:43 | 111K | |
![[IMG]](/icons/image2.gif) | 2109_FreshersWk_310a.jpg | 2025-06-03 11:43 | 110K | |
![[ ]](/icons/layout.gif) | Deferral-Protocol.pdf | 2024-07-17 15:48 | 109K | |
![[ ]](/icons/layout.gif) | Final Changes to Module Descriptors Major Structures.pdf | 2024-04-23 09:16 | 108K | |
![[ ]](/icons/layout.gif) | Prog_verf_checklist.pdf | 2025-07-01 15:18 | 105K | |
![[ ]](/icons/layout.gif) | Academic_Calendars2024_25.pdf | 2024-05-30 12:47 | 105K | |
![[ ]](/icons/layout.gif) | 05_08_25_ModuleDescriptorEditTo5thSept.pdf | 2025-08-06 08:42 | 105K | |
![[ ]](/icons/layout.gif) | 12_05_25_CMS_Closing_MajorEdits_VVPOCSStatement_ModulePlaces.pdf | 2025-05-12 12:42 | 103K | |
![[ ]](/icons/layout.gif) | ExaminationChecklist.pdf | 2024-05-02 12:17 | 101K | |
![[ ]](/icons/layout.gif) | RORAP.pdf | 2024-03-08 12:52 | 101K | |
![[TXT]](/icons/text.gif) | fancybox.umd.js | 2024-03-08 12:52 | 101K | |
![[ ]](/icons/layout.gif) | 02-09-24 Module and Major Edits Closing.pdf | 2024-09-02 15:45 | 98K | |
![[IMG]](/icons/image2.gif) | feedback.jpg | 2025-05-27 10:20 | 98K | |
![[ ]](/icons/layout.gif) | 2. 18 February Spring Trimester, Exam Question Papers Staff Email tagged.pdf | 2025-02-18 12:09 | 98K | |
![[ ]](/icons/layout.gif) | 21-11-24 Edits to Spring and Summer Modules open.pdf | 2024-11-21 12:42 | 98K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Regular.woff2 | 2024-03-08 12:52 | 97K | |
![[ ]](/icons/layout.gif) | OAProtocols.pdf | 2024-03-08 12:52 | 97K | |
![[ ]](/icons/unknown.gif) | la-brands-400.woff | 2025-07-02 03:10 | 96K | |
![[IMG]](/icons/image2.gif) | dashboard1-800x577.png | 2025-06-17 12:42 | 96K | |
![[ ]](/icons/layout.gif) | 09_05_24_EditsRequirements_Prior Learning_ModulePlacesClosing.pdf | 2025-05-15 14:12 | 95K | |
![[ ]](/icons/layout.gif) | Useful_Banner_Forms.pdf | 2025-02-20 13:09 | 95K | |
![[ ]](/icons/layout.gif) | 19-12-24 Spring and Summer Module Descriptor Edits Closing.pdf | 2024-12-20 09:12 | 95K | |
![[ ]](/icons/unknown.gif) | la-solid-900.woff2 | 2025-07-02 03:10 | 94K | |
![[ ]](/icons/layout.gif) | UCD Module Grade Descriptors.pdf | 2025-07-02 03:10 | 94K | |
![[ ]](/icons/layout.gif) | 22_04_25_CMS_ClosingFor202500SeptMajors.pdf | 2025-04-23 10:13 | 93K | |
![[ ]](/icons/layout.gif) | Comparing International Qualifications.pdf | 2025-06-12 12:19 | 93K | |
![[ ]](/icons/layout.gif) | 29-11-24 Edits to January Intake Majors Closing.pdf | 2024-11-29 10:12 | 93K | |
![[IMG]](/icons/image2.gif) | dashboard2-800x577.png | 2025-06-17 12:42 | 93K | |
![[IMG]](/icons/image2.gif) | ciara.jpeg | 2024-03-08 12:52 | 91K | |
![[ ]](/icons/layout.gif) | 10-10-24 Edits to January-intake Majors Open.pdf | 2024-10-11 08:46 | 91K | |
![[ ]](/icons/unknown.gif) | Programme Approvals Financial Analysis Template.xlsx | 2024-09-25 15:15 | 89K | |
![[ ]](/icons/layout.gif) | Staff Email Autumn Trimester Exams, Final Arrangements.pdf | 2024-03-08 12:52 | 89K | |
![[ ]](/icons/unknown.gif) | Ubuntu-Medium.woff2 | 2024-03-08 12:52 | 88K | |
![[ ]](/icons/layout.gif) | 28_07_25_EditsToModulePlaces_SEH_Closing.pdf | 2025-07-28 15:40 | 88K | |
![[IMG]](/icons/image2.gif) | 1805_Cygnets_019a.jpg | 2025-06-03 11:43 | 87K | |
![[IMG]](/icons/image2.gif) | ruth.jpeg | 2024-03-08 12:52 | 87K | |
![[IMG]](/icons/image2.gif) | jill.jpeg | 2024-03-08 12:52 | 87K | |
![[TXT]](/icons/text.gif) | choices.min.js | 2024-03-08 12:52 | 86K | |
![[ ]](/icons/unknown.gif) | Child of Employee Concession Form - new.docx | 2024-03-08 12:52 | 86K | |
![[ ]](/icons/unknown.gif) | Employee Fee Concession Form - new.docx | 2024-03-08 12:52 | 86K | |
![[IMG]](/icons/image2.gif) | Griffin_Kevin.jpg | 2024-03-08 12:52 | 85K | |
![[IMG]](/icons/image2.gif) | Final Stage only Award GPA calculation-552x617.png | 2024-12-13 14:43 | 84K | |
![[IMG]](/icons/image2.gif) | sarah.jpeg | 2024-03-08 12:52 | 84K | |
![[ ]](/icons/layout.gif) | ELR-staff.pdf | 2024-03-08 12:52 | 83K | |
![[ ]](/icons/unknown.gif) | la-brands-400.woff2 | 2025-07-02 03:10 | 83K | |
![[IMG]](/icons/image2.gif) | evan.jpeg | 2024-03-08 12:52 | 82K | |
![[IMG]](/icons/image2.gif) | connect 2.png | 2025-08-13 19:39 | 82K | |
![[ ]](/icons/layout.gif) | 19_06_25_registryupdate.pdf | 2025-06-20 13:42 | 81K | |
![[ ]](/icons/layout.gif) | 14_04_25_CMSCloseMayIntakeMajors.pdf | 2025-04-15 08:13 | 81K | |
![[ ]](/icons/layout.gif) | 30_06_25_FinalEdits_ModuleTrimester_Status_CareersStatements.pdf | 2025-07-01 10:20 | 81K | |
![[IMG]](/icons/image2.gif) | Science_Stairs.jpg | 2024-03-08 12:52 | 81K | |
![[IMG]](/icons/image2.gif) | joanna.jpeg | 2024-03-08 12:52 | 81K | |
![[ ]](/icons/layout.gif) | Autumn 23-24 Exam Question Papers Portal.pdf | 2024-03-08 12:52 | 80K | |
![[IMG]](/icons/image2.gif) | kate.jpeg | 2024-03-08 12:52 | 79K | |
![[IMG]](/icons/image2.gif) | exams_spring2025-800x424.png | 2025-06-17 12:42 | 79K | |
![[ ]](/icons/unknown.gif) | PDARF3 New Programme Academic Structure Proposal_Final Oct SEPT 2021 DRAFT.docx | 2024-09-27 12:45 | 78K | |
![[ ]](/icons/layout.gif) | 22_04_25_EditSummerModulesOpen.pdf | 2025-04-23 10:13 | 77K | |
![[ ]](/icons/layout.gif) | 16-05-24 CMS - Sept Intake Arrangements for Edits and Changes to Requirements & Prior Learning.pdf | 2024-05-16 16:17 | 77K | |
![[TXT]](/icons/text.gif) | bootstrap.bundle.min.js | 2024-03-08 12:52 | 76K | |
![[ ]](/icons/layout.gif) | 130325_Registry_update.pdf | 2025-03-13 15:44 | 76K | |
![[ ]](/icons/layout.gif) | Other Module Grades (further detail).pdf | 2024-12-13 14:43 | 73K | |
![[ ]](/icons/layout.gif) | Spring and Summer Module Edits Closing.pdf | 2024-04-23 09:16 | 72K | |
![[ ]](/icons/layout.gif) | Module Descriptors Open for Edit.pdf | 2024-04-23 09:16 | 71K | |
![[IMG]](/icons/image2.gif) | connect 3.png | 2025-08-13 19:39 | 71K | |
![[ ]](/icons/layout.gif) | 24-06-24 CMS Sections Closing.pdf | 2024-06-25 09:45 | 70K | |
![[ ]](/icons/layout.gif) | 11-09-24 Exemptions on the Basis of Exceptional Circumstances.pdf | 2024-09-12 08:45 | 69K | |
![[ ]](/icons/layout.gif) | 19_05_25_Edits_RequirementsPriorLearning_ModulePlaces.pdf | 2025-05-20 15:44 | 69K | |
![[IMG]](/icons/image2.gif) | fade-grid-left.svg | 2024-03-08 12:52 | 68K | |
![[ ]](/icons/unknown.gif) | PDARF4 Collaborative Programme Supplement_Final Sept 2020 DRAFT SEPT 2021.docx | 2024-09-27 12:45 | 68K | |
![[IMG]](/icons/image2.gif) | fade-grid-right.svg | 2024-03-08 12:52 | 67K | |
![[ ]](/icons/unknown.gif) | PDARF7 Programme Change Proposal_Final Oct 2020 SEPT 2021 DRAFT.docx | 2024-09-27 12:45 | 66K | |
![[IMG]](/icons/image2.gif) | exams_support-800x448.png | 2025-06-17 12:42 | 66K | |
![[ ]](/icons/layout.gif) | Guidelines for conducting a Viva Voce remotely .pdf | 2024-03-08 12:52 | 65K | |
![[IMG]](/icons/image2.gif) | noya_pic.jpg | 2025-08-22 14:09 | 64K | |
![[ ]](/icons/layout.gif) | 12_05_25_CMS_Closing_ModulePlaces.pdf | 2025-05-12 12:42 | 64K | |
![[IMG]](/icons/image2.gif) | structure.jpg | 2025-05-27 10:20 | 63K | |
![[ ]](/icons/unknown.gif) | PDARF6 Structured Elective 202425.docx | 2024-03-08 12:52 | 61K | |
![[ ]](/icons/unknown.gif) | PDARF 16 Structure Change Proposal.docx | 2024-03-08 12:52 | 61K | |
![[IMG]](/icons/image2.gif) | Chair Oversight of thesis revisions-606x171.png | 2025-03-24 15:44 | 61K | |
![[ ]](/icons/layout.gif) | SpringTrimesterChangesTimetablingTimelines.pdf | 2024-03-08 12:52 | 60K | |
![[ ]](/icons/layout.gif) | 202526 Module Descriptors Credit Split by Trimester Closing 27 June.pdf | 2025-06-24 18:20 | 60K | |
![[IMG]](/icons/image2.gif) | Elena Keany.jpg | 2024-06-27 10:15 | 59K | |
![[IMG]](/icons/image2.gif) | emma.jpeg | 2024-03-08 12:52 | 59K | |
![[IMG]](/icons/image2.gif) | lizanne (1).jpeg | 2024-03-08 12:52 | 58K | |
![[IMG]](/icons/image2.gif) | IT_Services_cropped.jpg | 2025-05-07 10:44 | 58K | |
![[ ]](/icons/layout.gif) | 13-03-25 CMS open for May-Intake Major Edits.pdf | 2025-03-13 17:12 | 58K | |
![[IMG]](/icons/image2.gif) | GB_request-600x384.png | 2025-05-23 11:13 | 58K | |
![[IMG]](/icons/image2.gif) | Supervisor What Happens Next.png | 2025-03-24 12:43 | 58K | |
![[IMG]](/icons/image2.gif) | Chair Oversight of thesis revisions.png | 2025-03-24 15:44 | 58K | |
![[IMG]](/icons/image2.gif) | Approval of Final Thesis revisions .jpg | 2025-03-24 15:44 | 57K | |
![[ ]](/icons/layout.gif) | Standard_Conversion_Grade_Scale_40_Pass.pdf | 2025-04-07 16:12 | 56K | |
![[ ]](/icons/unknown.gif) | PDARF8 Pathway Programme Proposal_Final Sept 2020.docx | 2024-03-08 12:52 | 56K | |
![[IMG]](/icons/image2.gif) | Submission of Preliminary Report Pic .jpg | 2025-03-24 15:44 | 55K | |
![[ ]](/icons/layout.gif) | 02-07-24 Final Module Trimester Status Changes.pdf | 2024-07-03 15:45 | 55K | |
![[ ]](/icons/layout.gif) | Intern-Examiner-Payment-Process-Map.pdf | 2024-03-08 12:52 | 54K | |
![[ ]](/icons/layout.gif) | Summer Module Edits Open &Assessment Strategy Changes.pdf | 2024-04-23 16:16 | 54K | |
![[IMG]](/icons/image2.gif) | Submission of JDR.png | 2025-03-24 15:44 | 54K | |
![[ ]](/icons/layout.gif) | Other Module Grades.pdf | 2024-12-13 14:43 | 54K | |
![[IMG]](/icons/image2.gif) | parchment_sample.jpg | 2024-03-08 12:52 | 54K | |
![[ ]](/icons/layout.gif) | Alternative Linear Conversion Grade Scale 40 per cent Pass.pdf | 2025-04-08 10:44 | 53K | |
![[IMG]](/icons/image2.gif) | 1104_JJ_Library_280-Sml.jpg | 2025-05-07 10:44 | 53K | |
![[IMG]](/icons/image2.gif) | Preliminary Reports.png | 2025-07-02 03:10 | 53K | |
![[ ]](/icons/layout.gif) | 2024-04-17 Edits to May-intake Majors Closing.pdf | 2024-04-18 07:46 | 51K | |
![[ ]](/icons/unknown.gif) | Details of Practical Experience.docx | 2024-03-08 12:52 | 51K | |
![[ ]](/icons/layout.gif) | Edits to May-intake Majors Open.pdf | 2024-04-23 09:16 | 49K | |
![[ ]](/icons/layout.gif) | 24-07-24 Module Places Closing Careers and Skills Statements.pdf | 2024-07-25 07:45 | 49K | |
![[IMG]](/icons/image2.gif) | How do I upload my thesis final doc 5_2_25.png | 2025-03-24 15:13 | 47K | |
![[IMG]](/icons/image2.gif) | Student_Types_2025-681x568.jpg | 2025-01-22 14:42 | 46K | |
![[IMG]](/icons/image2.gif) | Preliminary Reports-983x155.png | 2025-05-31 05:11 | 46K | |
![[TXT]](/icons/text.gif) | app.min.js | 2025-01-24 17:43 | 46K | |
![[IMG]](/icons/image2.gif) | rag_submit-600x364.png | 2025-05-23 11:13 | 46K | |
![[IMG]](/icons/image2.gif) | official_docs.jpg | 2025-06-10 14:17 | 46K | |
![[ ]](/icons/unknown.gif) | ACCE Change of Examination Committee Chair Form 090524.docx | 2024-05-09 15:18 | 45K | |
![[IMG]](/icons/image2.gif) | learning.jpg | 2025-02-06 16:40 | 44K | |
![[IMG]](/icons/image2.gif) | inperson exams-800x560.png | 2025-06-17 12:42 | 44K | |
![[ ]](/icons/unknown.gif) | PDARF14.docx | 2024-03-08 12:52 | 44K | |
![[ ]](/icons/layout.gif) | Virtual Viva Voce Examination Checklist.pdf | 2024-03-08 12:52 | 43K | |
![[ ]](/icons/layout.gif) | Where_to_find_UCD_student_information.pdf | 2025-02-22 00:09 | 42K | |
![[IMG]](/icons/image2.gif) | Component grades image2.PNG | 2024-12-13 14:43 | 42K | |
![[ ]](/icons/layout.gif) | ACCE SubCommittee TOR-1.pdf | 2024-03-08 12:52 | 41K | |
![[IMG]](/icons/image2.gif) | slider-200w1329h-enrollmentForm.jpg | 2024-03-08 12:52 | 41K | |
![[IMG]](/icons/image2.gif) | screen.jpg | 2025-02-06 10:39 | 41K | |
![[ ]](/icons/unknown.gif) | ACCE Change of Examination Committee Intern Form 090524.docx | 2024-05-09 15:18 | 41K | |
![[IMG]](/icons/image2.gif) | learning3.jpg | 2025-02-06 16:40 | 41K | |
![[IMG]](/icons/image2.gif) | GAP workflows image.PNG | 2024-12-13 14:43 | 40K | |
![[IMG]](/icons/image2.gif) | Example of Final and penultimate stages stage-weighted FinalPen Weighted 7030 (image) Ver2.PNG | 2024-12-13 14:43 | 40K | |
![[IMG]](/icons/image2.gif) | Connect 1.png | 2025-08-13 19:39 | 39K | |
![[IMG]](/icons/image2.gif) | Thesis submission 1 (4) 29 Jan.JPG | 2025-03-24 15:13 | 39K | |
![[IMG]](/icons/image2.gif) | Three Stage Degree Rule Example.PNG | 2024-12-13 14:43 | 38K | |
![[ ]](/icons/unknown.gif) | Lato-Italic.woff | 2024-03-08 12:52 | 38K | |
![[IMG]](/icons/image2.gif) | 18.02-520x152.PNG | 2025-02-18 16:09 | 37K | |
![[ ]](/icons/unknown.gif) | Lato-Regular.woff | 2024-03-08 12:52 | 37K | |
![[IMG]](/icons/image2.gif) | Supervisor Approves thesis for exam revised.jpg | 2025-03-24 12:43 | 36K | |
![[ ]](/icons/unknown.gif) | Lato-Bold.woff | 2024-03-08 12:52 | 36K | |
![[ ]](/icons/unknown.gif) | Lato-Black.woff | 2024-03-08 12:52 | 35K | |
![[IMG]](/icons/image2.gif) | Apprpval of Joint Degree Report .jpg | 2025-03-24 15:44 | 35K | |
![[ ]](/icons/unknown.gif) | Sample_Exam_Coversheet.docx | 2024-03-12 15:50 | 34K | |
![[IMG]](/icons/image2.gif) | pencils.jpg | 2025-02-06 16:40 | 34K | |
![[ ]](/icons/unknown.gif) | la-regular-400.eot | 2025-07-02 03:10 | 33K | |
![[IMG]](/icons/image2.gif) | graphs.jpg | 2025-02-06 10:39 | 33K | |
![[ ]](/icons/unknown.gif) | la-regular-400.ttf | 2025-07-02 03:10 | 33K | |
![[ ]](/icons/unknown.gif) | Sample Exam Paper Cover With Irish.docx | 2024-11-06 11:28 | 32K | |
![[IMG]](/icons/image2.gif) | Example of Calculating Semester GPA-554x332.png | 2024-12-13 14:43 | 32K | |
![[IMG]](/icons/image2.gif) | comms.jpg | 2025-02-06 10:39 | 31K | |
![[IMG]](/icons/image2.gif) | are_you_ready.jpg | 2025-02-06 10:39 | 31K | |
![[IMG]](/icons/image2.gif) | calendar2.jpg | 2025-02-06 10:39 | 31K | |
![[IMG]](/icons/image2.gif) | mcq.jpg | 2025-02-06 10:39 | 31K | |
![[IMG]](/icons/image2.gif) | writing.jpg | 2025-02-06 10:39 | 30K | |
![[IMG]](/icons/image2.gif) | learning4.jpg | 2025-02-06 16:40 | 30K | |
![[IMG]](/icons/image2.gif) | image (10)-846x166.png | 2025-03-24 12:43 | 30K | |
![[IMG]](/icons/image2.gif) | Assessment types.png | 2024-12-13 14:43 | 30K | |
![[ ]](/icons/unknown.gif) | Lato-Italic.woff2 | 2024-03-08 12:52 | 30K | |
![[IMG]](/icons/image2.gif) | calendar3.jpg | 2025-02-06 10:39 | 29K | |
![[ ]](/icons/unknown.gif) | Lato-Regular.woff2 | 2024-03-08 12:52 | 29K | |
![[ ]](/icons/unknown.gif) | Lato-Bold.woff2 | 2024-03-08 12:52 | 28K | |
![[IMG]](/icons/image2.gif) | laptop_closing.jpg | 2025-02-06 10:39 | 28K | |
![[ ]](/icons/unknown.gif) | Lato-Black.woff2 | 2024-03-08 12:52 | 28K | |
![[IMG]](/icons/image2.gif) | clock.jpg | 2025-02-06 10:39 | 28K | |
![[IMG]](/icons/image2.gif) | supersubmit1-800x101.png | 2025-03-24 12:43 | 28K | |
![[ ]](/icons/layout.gif) | UCD_Academic_Level_Descriptors.pdf | 2024-03-08 12:52 | 27K | |
![[IMG]](/icons/image2.gif) | working.jpg | 2025-02-06 10:39 | 27K | |
![[IMG]](/icons/image2.gif) | learning2.jpg | 2025-02-06 16:40 | 27K | |
![[IMG]](/icons/image2.gif) | calendar.jpg | 2025-02-06 10:39 | 26K | |
![[IMG]](/icons/image2.gif) | Component gpn grades.PNG | 2024-12-13 14:43 | 26K | |
![[IMG]](/icons/image2.gif) | Standard Module Overall Grades.png | 2024-12-13 14:43 | 22K | |
![[IMG]](/icons/image2.gif) | apple-touch-icon.png | 2025-07-02 03:10 | 22K | |
![[ ]](/icons/layout.gif) | Proposal Form AEGROTAT AND POSTHUMOUS AWARD.pdf | 2024-03-08 12:52 | 22K | |
![[IMG]](/icons/image2.gif) | paola.jpg | 2024-03-08 12:52 | 22K | |
![[ ]](/icons/layout.gif) | Example_of_UCD_Module_Descriptor.pdf | 2024-03-08 12:52 | 21K | |
![[IMG]](/icons/image2.gif) | Image of Hardbound Thesis-537x385.jpg | 2025-03-24 15:44 | 20K | |
![[IMG]](/icons/image2.gif) | grid-repeat.png | 2025-07-02 03:10 | 20K | |
![[IMG]](/icons/image2.gif) | logo-footer.svg | 2024-03-08 12:52 | 19K | |
![[IMG]](/icons/image2.gif) | Module Resit Assessment Grade Scale.png | 2024-12-13 14:43 | 19K | |
![[IMG]](/icons/image2.gif) | crest-ucd.svg | 2024-03-08 12:52 | 18K | |
![[IMG]](/icons/image2.gif) | karen.jpeg | 2024-03-08 12:52 | 18K | |
![[IMG]](/icons/image2.gif) | idea.jpg | 2025-02-06 16:40 | 17K | |
![[IMG]](/icons/image2.gif) | Pass Fail Module Grades.png | 2024-12-13 14:43 | 17K | |
![[ ]](/icons/unknown.gif) | la-regular-400.woff | 2025-07-02 03:10 | 15K | |
![[IMG]](/icons/image2.gif) | super_permit2-800x86.png | 2025-03-24 12:43 | 14K | |
![[IMG]](/icons/image2.gif) | Combined PDF on Structure Report-646x99.PNG | 2025-02-13 15:09 | 13K | |
![[IMG]](/icons/image2.gif) | Other Modules grades (synospis).png | 2024-12-13 14:43 | 13K | |
![[IMG]](/icons/image2.gif) | Repeat Module Grade Scale.png | 2024-12-13 14:43 | 13K | |
![[IMG]](/icons/image2.gif) | REG007_Lake.jpg | 2024-03-08 12:52 | 13K | |
![[ ]](/icons/unknown.gif) | la-regular-400.woff2 | 2025-07-02 03:10 | 13K | |
![[IMG]](/icons/image2.gif) | How to calculate the QPV image.png | 2024-12-13 14:43 | 11K | |
![[IMG]](/icons/image2.gif) | Supervisor Approves thesis for exam pic 3.jpg | 2025-03-24 12:43 | 9.0K | |
![[IMG]](/icons/image2.gif) | Grade Scale for Passed In Module Component repeat.png | 2024-12-13 14:43 | 7.9K | |
![[IMG]](/icons/image2.gif) | 120px-telephone-dialer.jpg | 2024-03-08 12:52 | 7.7K | |
![[IMG]](/icons/image2.gif) | In Module Resit Grade Scale.png | 2024-12-13 14:43 | 7.3K | |
![[IMG]](/icons/image2.gif) | 120px-lake-night.jpg | 2024-03-08 12:52 | 6.9K | |
![[IMG]](/icons/image2.gif) | Wellbeing4.jpg | 2025-06-03 11:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | icomoon.svg | 2025-03-19 09:44 | 1.9K | |
![[IMG]](/icons/image2.gif) | favicon-32x32.png | 2025-07-02 03:10 | 1.9K | |
![[ ]](/icons/unknown.gif) | icomoon.eot | 2025-03-19 09:44 | 1.6K | |
![[ ]](/icons/unknown.gif) | icomoon.woff | 2025-03-19 09:44 | 1.5K | |
![[ ]](/icons/unknown.gif) | icomoon.ttf | 2025-03-19 09:44 | 1.4K | |
![[IMG]](/icons/image2.gif) | favicon-16x16.png | 2025-07-02 03:10 | 781 | |
![[IMG]](/icons/image2.gif) | icon-search.svg | 2024-03-08 12:52 | 640 | |
![[IMG]](/icons/image2.gif) | icon-tiles.svg | 2024-03-08 12:52 | 639 | |
![[IMG]](/icons/image2.gif) | icon-union.svg | 2024-03-08 12:52 | 595 | |
![[IMG]](/icons/image2.gif) | icon-course.svg | 2024-03-08 12:52 | 559 | |
![[IMG]](/icons/image2.gif) | select-arrow.svg | 2024-03-08 12:52 | 515 | |
![[IMG]](/icons/image2.gif) | quote.svg | 2024-03-08 12:52 | 300 | |
![[IMG]](/icons/image2.gif) | union-plus.svg | 2024-03-08 12:52 | 274 | |
![[IMG]](/icons/image2.gif) | pause-icon.svg | 2024-03-08 12:52 | 270 | |
![[IMG]](/icons/image2.gif) | Polygon-green-bright-bottom-left.svg | 2024-03-08 12:52 | 260 | |
![[IMG]](/icons/image2.gif) | Polygon-yellow-top-left.svg | 2024-03-08 12:52 | 236 | |
![[IMG]](/icons/image2.gif) | icon-plus.svg | 2024-03-08 12:52 | 234 | |
![[IMG]](/icons/image2.gif) | icon-play.svg | 2024-03-08 12:52 | 225 | |
![[IMG]](/icons/image2.gif) | Rectangle--blue-bottom-left.svg | 2024-03-08 12:52 | 224 | |
![[IMG]](/icons/image2.gif) | play-icon.svg | 2024-03-08 12:52 | 222 | |
![[IMG]](/icons/image2.gif) | Rectangle--blue-top-right.svg | 2024-03-08 12:52 | 218 | |
![[IMG]](/icons/image2.gif) | Polygon-yellow-top-right.svg | 2024-03-08 12:52 | 210 | |
![[IMG]](/icons/image2.gif) | Polygon-blue-top-left.svg | 2024-03-08 12:52 | 210 | |
![[IMG]](/icons/image2.gif) | Polygon-green-bottom-right.svg | 2024-03-08 12:52 | 204 | |
![[IMG]](/icons/image2.gif) | Polygon--blue-bottom-right.svg | 2024-03-08 12:52 | 204 | |
![[IMG]](/icons/image2.gif) | union-minus.svg | 2024-03-08 12:52 | 179 | |
![[IMG]](/icons/image2.gif) | Rectangle--blue-top-left.svg | 2024-03-08 12:52 | 178 | |
![[IMG]](/icons/image2.gif) | Rectangle--yellow-top-left.svg | 2024-03-08 12:52 | 177 | |
![[IMG]](/icons/image2.gif) | Rectangle--green-top-left.svg | 2024-03-08 12:52 | 177 | |
![[IMG]](/icons/image2.gif) | Rectangle--yellow-top-right.svg | 2024-03-08 12:52 | 176 | |
![[IMG]](/icons/image2.gif) | Rectangle--green-top-right.svg | 2024-03-08 12:52 | 175 | |
![[IMG]](/icons/image2.gif) | Rectangle--yellow-bottom-left.svg | 2024-03-08 12:52 | 167 | |
![[IMG]](/icons/image2.gif) | Rectangle--green-bottom-left.svg | 2024-03-08 12:52 | 167 | |
![[IMG]](/icons/image2.gif) | Polygon-big.svg | 2024-03-08 12:52 | 167 | |
![[IMG]](/icons/image2.gif) | Polygon-green-big.svg | 2024-03-08 12:52 | 164 | |
![[IMG]](/icons/image2.gif) | Polygon-green2-bottom-left.svg | 2024-03-08 12:52 | 161 | |
|